Oleoresin tumeric
PubChem CID: 11979920
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Oleoresin tumeric, NSC670972, NSC-670972, (1E,6E)-1,7-bis(4-hydroxy-3-methoxy-phenyl)hepta-1,6-diene-3,5-dione, (1E,6E)-1,7-bis(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione, (1E,6E)-1-(4-hydroxy-3-methoxy-phenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 251.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Linear diarylheptanoids |
| Deep Smiles | O=CCC=O)/C=C/cccccc6))O)))))))))/C=C/cccccc6))O.COccc/C=C/C=O)CC=O)/C=C/cccccc6)OC)))O))))))))))))ccc6O.COccc/C=C/C=O)CC=O)/C=C/cccccc6))O))))))))))))ccc6O |
| Heavy Atom Count | 75.0 |
| Classyfire Class | Diarylheptanoids |
| Classyfire Subclass | Linear diarylheptanoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1420.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione, (1E,6E)-1,7-bis(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione, (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C60H54O15 |
| Inchi Key | IYXGMLAORQQRHW-LITQUBMNSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 21.0 |
| Synonyms | oleoresin |
| Esol Class | Insoluble |
| Functional Groups | c/C=C/C(C)=O, cO, cOC |
| Compound Name | Oleoresin tumeric |
| Exact Mass | 1014.35 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 1014.35 |
| Hydrogen Bond Acceptor Count | 15.0 |
| Molecular Weight | 1015.1 |
| Gi Absorption | False |
| Covalent Unit Count | 3.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 6.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C21H20O6.C20H18O5.C19H16O4/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2, 1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14, 20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h3-12,24-25H,13H2,1-2H3, 2-12,21,24H,13H2,1H3, 1-12,20-21H,13H2/b7-3+,8-4+, 9-4+,10-5+, 11-5+,12-6+ |
| Smiles | COC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC=C(C=C2)O)O.COC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O.C1=CC(=CC=C1/C=C/C(=O)CC(=O)/C=C/C2=CC=C(C=C2)O)O |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 6.0 |
| Egan Rule | False |
| Np Classifier Superclass | Diarylheptanoids |
- 1. Outgoing r'ship
FOUND_INto/from Ailanthus Triphysa (Plant) Rel Props:Reference:ISBN:9788172360481 - 2. Outgoing r'ship
FOUND_INto/from Canarium Indicum (Plant) Rel Props:Reference:ISBN:9780387706375 - 3. Outgoing r'ship
FOUND_INto/from Canarium Strictum (Plant) Rel Props:Reference:ISBN:9788172360481 - 4. Outgoing r'ship
FOUND_INto/from Cleome Gynandra (Plant) Rel Props:Reference:ISBN:9788190115131 - 5. Outgoing r'ship
FOUND_INto/from Curcuma Longa (Plant) Rel Props:Reference:ISBN:9788172360481 - 6. Outgoing r'ship
FOUND_INto/from Dalbergia Sissoo (Plant) Rel Props:Reference:ISBN:9770972795006 - 7. Outgoing r'ship
FOUND_INto/from Dipterocarpus Gracilis (Plant) Rel Props:Reference:ISBN:9770972795006; ISBN:9788172360481 - 8. Outgoing r'ship
FOUND_INto/from Dipterocarpus Indicus (Plant) Rel Props:Reference:ISBN:9770972795006; ISBN:9788172360481 - 9. Outgoing r'ship
FOUND_INto/from Hardwickia Mannii (Plant) Rel Props:Reference:ISBN:9770972795006 - 10. Outgoing r'ship
FOUND_INto/from Kaempferia Galanga (Plant) Rel Props:Reference:ISBN:9770972795006 - 11. Outgoing r'ship
FOUND_INto/from Kingiodendron Pinnatum (Plant) Rel Props:Reference:ISBN:9788172360481; ISBN:9788185042053 - 12. Outgoing r'ship
FOUND_INto/from Mammea Suriga (Plant) Rel Props:Reference:ISBN:9770972795006 - 13. Outgoing r'ship
FOUND_INto/from Pinus Gerardiana (Plant) Rel Props:Reference:ISBN:9780387706375 - 14. Outgoing r'ship
FOUND_INto/from Rauvolfia Serpentina (Plant) Rel Props:Reference:ISBN:9788172361266 - 15. Outgoing r'ship
FOUND_INto/from Syzygium Jambos (Plant) Rel Props:Reference:ISBN:9788172361266 - 16. Outgoing r'ship
FOUND_INto/from Tanacetum Cinerariifolium (Plant) Rel Props:Reference:ISBN:9788172360481 - 17. Outgoing r'ship
FOUND_INto/from Vateria Indica (Plant) Rel Props:Reference:ISBN:9780387706375; ISBN:9788185042114 - 18. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Reference:ISBN:9788172362140