(1R,4R,7R,8S,9R,11R)-9-Tert-butyl-7,9-dihydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione
PubChem CID: 11875005
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (-)-Bilobalide, (1R,4R,7R,8S,9R,11R)-9-Tert-butyl-7,9-dihydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione, (1S,4R,7S,8S,9R,11S)-9-tert-butyl-7,9-dihydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione, MOLPUWBMSBJXER-NRSGSQFTSA-N, AKOS037514571, NCGC00385451-01 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 119.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CC2CC(C)C34CC(C)CC3CCC24C1 |
| Deep Smiles | O=CO[C@@H][C@@]C5)C=O)O[C@H][C@]5[C@]C8)O)CC)C)C)))[C@H]O)C=O)O5 |
| Heavy Atom Count | 23.0 |
| Classyfire Class | Prenol lipids |
| Description | Constituent of leaves of Ginkgo biloba (ginkgo). Bilobalide A is found in ginkgo nuts and fats and oils. |
| Scaffold Graph Node Level | OC1CC23CCC4OC(O)CC42C(O)OC3O1 |
| Classyfire Subclass | Terpene lactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 650.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | (1S,4R,7S,8S,9R,11S)-9-tert-butyl-7,9-dihydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione |
| Prediction Hob | 1.0 |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | -0.3 |
| Superclass | Lipids and lipid-like molecules |
| Subclass | Terpene lactones |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H18O8 |
| Scaffold Graph Node Bond Level | O=C1CC23CCC4OC(=O)CC42C(=O)OC3O1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | MOLPUWBMSBJXER-NRSGSQFTSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8 |
| Logs | -4.25 |
| Rotatable Bond Count | 1.0 |
| State | Solid |
| Logd | 0.224 |
| Synonyms | Bilobalide, (-)-Bilobalide, bilobalide a |
| Esol Class | Very soluble |
| Functional Groups | CC(=O)OC, CO, O=C1CC2CC(=O)O[C@H]2O1 |
| Compound Name | (1R,4R,7R,8S,9R,11R)-9-Tert-butyl-7,9-dihydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 326.1 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 326.1 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 326.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -1.6269662 |
| Inchi | InChI=1S/C15H18O8/c1-12(2,3)14(20)4-6-13(5-7(16)21-6)10(19)23-11-15(13,14)8(17)9(18)22-11/h6,8,11,17,20H,4-5H2,1-3H3/t6-,8+,11-,13-,14+,15+/m0/s1 |
| Smiles | CC(C)(C)[C@@]1(C[C@H]2[C@@]3([C@]14[C@@H](C(=O)O[C@H]4OC3=O)O)CC(=O)O2)O |
| Nring | 4.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Ginkgolides and bilobalides |
- 1. Outgoing r'ship
FOUND_INto/from Ginkgo Biloba (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Ginkgo Semen (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Ipomoea Biloba (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Magnolia Biloba (Plant) Rel Props:Reference: