Ambap17754-44-8
PubChem CID: 118701294
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | atractyloside, C09064, Ambap17754-44-8, AC1L9C35 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 272.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CC23CCC4CCC(CC5CCCCC5)CC4C2CCC1C3 |
| Np Classifier Class | Norkaurane diterpenoids |
| Deep Smiles | OC[C@H]O[C@@H]O[C@@H]C[C@@H]C=O)O))C[C@]C6)C)CCC[C@@H]C[C@@]6CC%10))[C@@H]O)C5=C)))))))))))))))[C@@H][C@H][C@@H]6OS=O)=O)[O-]))))OS=O)=O)[O-]))))OC=O)CCC)C.[K+].[K+] |
| Heavy Atom Count | 50.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | CC1CC23CCC4CCC(OC5CCCCO5)CC4C2CCC1C3 |
| Classyfire Subclass | Terpene glycosides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1440.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 11.0 |
| Iupac Name | dipotassium, [(2R,3R,4R,5R,6R)-2-[[(1R,5R,7R,9R,13R,15S)-5-carboxy-15-hydroxy-9-methyl-14-methylidene-7-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]oxy]-6-(hydroxymethyl)-3-(3-methylbutanoyloxy)-5-sulfonatooxyoxan-4-yl] sulfate |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Gsk 4 400 Rule | False |
| Molecular Formula | C30H44K2O16S2 |
| Scaffold Graph Node Bond Level | C=C1CC23CCC4CCC(OC5CCCCO5)CC4C2CCC1C3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | IUCNQFHEWLYECJ-BDQDKTDDSA-L |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8666666666666667 |
| Logs | -0.046 |
| Rotatable Bond Count | 10.0 |
| Logd | -0.024 |
| Synonyms | atractyloside |
| Esol Class | Moderately soluble |
| Functional Groups | C=C(C)C, CC(=O)O, CC(=O)OC, CO, COS(=O)(=O)[O-], CO[C@@H](C)OC, [K+] |
| Compound Name | Ambap17754-44-8 |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 802.134 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 802.134 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 803.0 |
| Gi Absorption | False |
| Covalent Unit Count | 3.0 |
| Total Atom Stereocenter Count | 13.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C30H46O16S2.2K/c1-14(2)9-22(32)44-25-24(46-48(39,40)41)23(45-47(36,37)38)20(13-31)43-28(25)42-17-10-18(27(34)35)19-7-8-30-11-16(15(3)26(30)33)5-6-21(30)29(19,4)12-17, , /h14,16-21,23-26,28,31,33H,3,5-13H2,1-2,4H3,(H,34,35)(H,36,37,38)(H,39,40,41), , /q, 2*+1/p-2/t16-,17-,18-,19?,20-,21?,23-,24+,25-,26+,28-,29-,30-, , /m1../s1 |
| Smiles | CC(C)CC(=O)O[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O[C@@H]2C[C@H](C3CC[C@@]45C[C@@H](CCC4[C@@]3(C2)C)C(=C)[C@@H]5O)C(=O)O)CO)OS(=O)(=O)[O-])OS(=O)(=O)[O-].[K+].[K+] |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Coffea Arabica (Plant) Rel Props:Reference:ISBN:9780387706375 - 2. Outgoing r'ship
FOUND_INto/from Xanthium Sibiricum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Xanthium Strumarium (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all