Triphenylphosphine
PubChem CID: 11776
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | TRIPHENYLPHOSPHINE, 603-35-0, Triphenylphosphane, Triphenyl phosphine, Phosphine, triphenyl-, Triphenylphosphorus, Triphenylphosphide, triphenyl-phosphane, Phosphorustriphenyl, Trifenylfosfin, triphenylphosphin, Phosphorus triphenyl, PPh3, PP 360, NSC 10, Ph3P, CCRIS 4889, NSC 215203, DTXSID5026251, triphenylphosphan, HSDB 4266, EINECS 210-036-0, triphenylphosphorane, triphenyl phosphorus, BRN 0610776, NSC-10, UNII-26D26OA393, MFCD00003043, 26D26OA393, NSC-215203, DTXCID906251, CHEBI:183318, EC 210-036-0, 4-16-00-00951 (Beilstein Handbook Reference), triphenylphoshine, WLN: RPR&R, Trifenylfosfin [Czech], MFCD20489348, TRIPHENYL PHOSPHOROUS, CAS-603-35-0, C18H15P, Triphenyl phosphine resin, 14264-16-5, triphenyphospine, tripenylphosphine, triphenyiphoshine, triphenylphophine, triphenylphospine, tripheylphosphine, Triphenylphospane, Triphenyphosphine, tripbenylphosphine, triphenyiphosphine, tri-phenylphospine, triphenyl phophine, triphenyl phosphin, triphenyl phospine, tri-phenylphosphine, triphenyl phosphide, triphenyl-phosphine, triphenylphosphine-, triphenyl- phosphine, 58079-51-9, Triphenylphosphine, 98%, Triphenylphosphine, flakes, Triphenylphosphine, powder, Diphenylphosphinopolystyrene, SCHEMBL101, (Ph)3P, P(Ph)3, NSC10, Triphenylphosphine 1M in THF, TRIPHENYLPHOSPHINE [MI], SCHEMBL1679860, P 100 (ACCELERATOR), CHEMBL1448331, TRIPHENYLPHOSPHINE [HSDB], (C6H5)3P, BCP01148, P(C6H5)3, Tox21_202114, Tox21_303294, NSC215203, STL185621, AKOS009031542, Triphenylphosphine, >=95.0% (GC), AT26025, FT48242, NCGC00091416-01, NCGC00091416-03, NCGC00257211-01, NCGC00259663-01, BP-12577, Triphenylphosphine, ReagentPlus(R), 99%, DB-050422, Bis(triphenylphosphine)nickel(II)dichloride?, NS00002889, T0519, EN300-19636, A15679, Triphenylphosphine, ReagentPlus(R), >=98.5%, Q115493, F1642-0085, Triphenylphosphine polystyrene (200-400 mesh, 0.8-1.5 mmol/g), 210-036-0, FPZ, InChI=1/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15, JandaJel(TM)-triphenylphosphine, 50-100 mesh, extent of labeling: ~3.0 mmol/g P loading, 2 % cross-linked, triphenylphosphine, phosphine, triphenyl-, triphenylphosphane, triphenyl phosphine, triphenylphosphine phosphine, triphenyl- triphenylphosphane triphenyl phosphine |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC(C(C2CCCCC2)C2CCCCC2)CC1 |
| Deep Smiles | cccccc6))Pcccccc6))))))cccccc6 |
| Heavy Atom Count | 19.0 |
| Classyfire Class | Benzene and substituted derivatives |
| Scaffold Graph Node Level | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1 |
| Classyfire Subclass | Phenylphosphines and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 202.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | triphenylphosphane |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 4.6 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H15P |
| Scaffold Graph Node Bond Level | c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| Inchi Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | triphenyl phosphine |
| Esol Class | Moderately soluble |
| Functional Groups | cP(c)c |
| Compound Name | Triphenylphosphine |
| Exact Mass | 262.091 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 262.091 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 262.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| Smiles | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Mukia Maderaspatana (Plant) Rel Props:Reference:ISBN:9770972795006