5-[(8Z,11Z)-pentadeca-8,11-dien-1-yl]benzene-1,3-diol
PubChem CID: 11702450
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cardol diene, Cardoldiene, 5-{8(Z),11(Z)-pentadecadienyl}resorcinol, 5-[(8Z,11Z)-pentadeca-8,11-dien-1-yl]benzene-1,3-diol, CHEMBL459604, 5-[(8Z,11Z)-pentadeca-8,11-dienyl]benzene-1,3-diol, 5-(8,11-Pentadecadienyl)-1,3-benzenediol, 5-(8Z,11Z)-8,11-PENTADECADIENYLRESORCINOL, 5-((8Z,11Z)-pentadeca-8,11-dienyl)benzene-1,3-diol, 5-((8Z,11Z)-pentadeca-8,11-dien-1-yl)benzene-1,3-diol, SCHEMBL9475761, DTXSID70872872, CHEBI:183673, BDBM50292428, LMPK15030021, AKOS030555484, HY-118495, CS-0066136, 5-(pentadeca-8,11-dienyl)benzene-1,3-diol, 5-((8Z,11Z)-pentadeca-8,11-dien-1-yl)resorcinol |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Catechols with side chains |
| Deep Smiles | CCC/C=CC/C=CCCCCCCCcccO)ccc6)O |
| Heavy Atom Count | 23.0 |
| Classyfire Class | Phenols |
| Description | Isolated from Anacardium occidentale (cashew). 5-(8,11-Pentadecadienyl)-1,3-benzenediol is found in nuts. |
| Scaffold Graph Node Level | C1CCCCC1 |
| Classyfire Subclass | Benzenediols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 312.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P08170, O42713 |
| Iupac Name | 5-[(8Z,11Z)-pentadeca-8,11-dienyl]benzene-1,3-diol |
| Prediction Hob | 1.0 |
| Class | Phenols |
| Veber Rule | False |
| Classyfire Superclass | Benzenoids |
| Xlogp | 7.4 |
| Superclass | Benzenoids |
| Subclass | Benzenediols |
| Gsk 4 400 Rule | False |
| Molecular Formula | C21H32O2 |
| Scaffold Graph Node Bond Level | c1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | UFMJCOLGRWKUKO-UTOQUPLUSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5238095238095238 |
| Logs | -3.031 |
| Rotatable Bond Count | 12.0 |
| State | Solid |
| Logd | 4.517 |
| Synonyms | 5-(8,11-Pentadecadienyl)-1,3-benzenediol, Cardoldiene, 5-{8(Z), 11(Z)-Pentadecadienyl}Resorcinol, 1-pentadeca-delta-dienyl-2,3-dihydroxybenzene |
| Esol Class | Highly soluble |
| Functional Groups | C/C=CC, cO |
| Compound Name | 5-[(8Z,11Z)-pentadeca-8,11-dien-1-yl]benzene-1,3-diol |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 316.24 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 316.24 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 316.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -5.884150478260869 |
| Inchi | InChI=1S/C21H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-20(22)18-21(23)17-19/h4-5,7-8,16-18,22-23H,2-3,6,9-15H2,1H3/b5-4-,8-7- |
| Smiles | CCC/C=C\C/C=C\CCCCCCCC1=CC(=CC(=C1)O)O |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 2.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Resorcinols |
| Np Classifier Superclass | Aromatic polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Anacardium Occidentale (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Aronia Arbutifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Clibadium Mexiae (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Discaria Serratifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Justicia Hayatai (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Pteris Dactylina (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Pyrostegia Venusta (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Semecarpus Anacardium (Plant) Rel Props:Reference:ISBN:9788171360536 - 9. Outgoing r'ship
FOUND_INto/from Viscaria Viscosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all