(4aS,6R,8aS)-4a-hydroxy-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-one
PubChem CID: 11651583
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | alpha-Rotunol, 24405-56-9, CHEBI:196136, DTXSID901112986, (4aS,6R,8aS)-4a-hydroxy-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-one, (4aS,6R,8aS)-4a,5,6,7,8,8a-Hexahydro-4a-hydroxy-4,8a-dimethyl-6-(1-methylethenyl)-2(1H)-naphthalenone |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCCCC2C1 |
| Np Classifier Class | Eudesmane sesquiterpenoids |
| Deep Smiles | O=CC=CC)[C@][C@@]C6)C)CC[C@H]C6)C=C)C))))))O |
| Heavy Atom Count | 17.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CCC2CCCCC2C1 |
| Classyfire Subclass | Sesquiterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 407.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (4aS,6R,8aS)-4a-hydroxy-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-one |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.4 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H22O2 |
| Scaffold Graph Node Bond Level | O=C1C=CC2CCCCC2C1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | WDFLKCAWQQMJCA-VHDGCEQUSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.6666666666666666 |
| Logs | -3.282 |
| Rotatable Bond Count | 1.0 |
| Logd | 2.163 |
| Synonyms | alpha rotunol, alpha-rotunol, α-rotunol |
| Esol Class | Soluble |
| Functional Groups | C=C(C)C, CC(=O)C=C(C)C, CO |
| Compound Name | (4aS,6R,8aS)-4a-hydroxy-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-one |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 234.162 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 234.162 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 234.33 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.7200018000000004 |
| Inchi | InChI=1S/C15H22O2/c1-10(2)12-5-6-14(4)9-13(16)7-11(3)15(14,17)8-12/h7,12,17H,1,5-6,8-9H2,2-4H3/t12-,14+,15-/m1/s1 |
| Smiles | CC1=CC(=O)C[C@]2([C@]1(C[C@@H](CC2)C(=C)C)O)C |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Cyperus Alopecuroides (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Cyperus Amabilis (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Cyperus Articulatus (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Cyperus Bulbosus (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Cyperus Capitatus (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Cyperus Corymbosus (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Cyperus Difformis (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Cyperus Distans (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Cyperus Esculentus (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Cyperus Exaltatus (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Cyperus Haspan (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Cyperus Iria (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Cyperus Laevigatus (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Cyperus Longus (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Cyperus Malaccensis (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Cyperus Minicus (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Cyperus Nipponicus (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Cyperus Opecuroides (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Cyperus Pangorei (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Cyperus Papyrus (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Cyperus Pedunculatus (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Cyperus Pertenius (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Cyperus Pilosus (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Cyperus Platyphyllus (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Cyperus Rotundus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 26. Outgoing r'ship
FOUND_INto/from Cyperus Scariosus (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Cyperus Serotinus (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Cyperus Stoloniferus (Plant) Rel Props:Reference: