Isobutyl isovalerate
PubChem CID: 11514
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ISOBUTYL ISOVALERATE, 589-59-3, 2-Methylpropyl 3-methylbutanoate, Butanoic acid, 3-methyl-, 2-methylpropyl ester, Isovaleric acid, isobutyl ester, 2-Methylpropyl 3-methylbutyrate, Isobutylisovalerate, 2-Methylpropyl isovalerate, Isobutyl isopentanoate, Isobutyl 3-methylpropanoate, Isobutyl isovalerate (natural), Isovaleric Acid Isobutyl Ester, FEMA No. 3369, Isobutyl 3-methylbutanoate, NSC 6993, 2-methylpropyl-3-methylbutyrate, EINECS 209-653-8, UNII-6VCJ0UB168, BRN 1702649, 6VCJ0UB168, AI3-33586, NSC-6993, MFCD00048349, DTXSID5060431, FEMA 3369, ISOBUTYL ISOVALERATE [MI], 2-METHYL PROPYL 3-METHYL BUTYRATE, 2-METHYLPROPYL 3-METHYLBUTYRATE [FHFI], 2-METHYL PROPYL 3-METHYL BUTYRATE [FCC], 3-Methylbutanoic acid 2-methylpropyl ester, Butyl isovalerate, natural, Isobutyl 3-methyl butyrate, SCHEMBL128660, DTXCID6042494, CHEBI:89086, NSC6993, WLN: 1Y1&1VO1Y1&1, 2-Methylpropyl 3-methylbutanoic acid, LMFA07010727, AKOS024437963, Isobutyl isovalerate, >=98.0% (GC), LS-13709, DB-053295, CS-0199173, I0197, NS00012680, E79207, Isobutyl isovalerate, natural (US), >=99%, FG, Q27161264, 209-653-8 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | CCCOC=O)CCC)C))))))C |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Fatty acyls |
| Description | Present in many plants. Flavouring ingredient. 2-Methylpropyl 3-methylbutanoate is found in roman camomile, fig, and pepper (spice). |
| Classyfire Subclass | Fatty acid esters |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 117.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-methylpropyl 3-methylbutanoate |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Fatty Acyls |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.7 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty acid esters |
| Gsk 4 400 Rule | True |
| Molecular Formula | C9H18O2 |
| Prediction Swissadme | 1.0 |
| Inchi Key | KEBDNKNVCHQIJU-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8888888888888888 |
| Logs | -2.889 |
| Rotatable Bond Count | 5.0 |
| Logd | 3.696 |
| Synonyms | 2-Methylpropyl 3-methylbutanoate, 2-Methylpropyl 3-methylbutyrate, 2-Methylpropyl isovalerate, 2-methylpropyl-3-methylbutyrate, Butanoic acid, 3-methyl-, 2-methylpropyl ester, FEMA 3369, Isobutyl 3-methylbutanoate, Isobutyl 3-methylpropanoate, Isobutyl isopentanoate, Isobutyl isovalerate, Isobutylisovalerate, Isovaleric acid, isobutyl ester, 2-Methylpropyl 3-methylbutanoic acid, 2-Methylpropyl-3-methylbutyrate, (syn_ isobutyl isovalerate), 2-methylpropyl 3-methylbutanoate, isobutyl isovalerate |
| Esol Class | Soluble |
| Functional Groups | COC(C)=O |
| Compound Name | Isobutyl isovalerate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 158.131 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 158.131 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 158.24 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -2.1983942 |
| Inchi | InChI=1S/C9H18O2/c1-7(2)5-9(10)11-6-8(3)4/h7-8H,5-6H2,1-4H3 |
| Smiles | CC(C)CC(=O)OCC(C)C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Fatty acid esters |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Ammi Visnaga (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2015.1085813 - 2. Outgoing r'ship
FOUND_INto/from Artocarpus Heterophyllus (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730070604 - 3. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2010.9700383 - 4. Outgoing r'ship
FOUND_INto/from Chamaemelum Nobile (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Corymbia Calophylla (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199611)11:6<339::aid-ffj595>3.0.co;2-x - 6. Outgoing r'ship
FOUND_INto/from Elsholtzia Ciliata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Eucalyptus Baueriana (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 8. Outgoing r'ship
FOUND_INto/from Eucalyptus Camaldulensis (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199605)11:3<145::aid-ffj565>3.0.co;2-o - 9. Outgoing r'ship
FOUND_INto/from Eucalyptus Crebra (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 10. Outgoing r'ship
FOUND_INto/from Eucalyptus Globulus (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199605)11:3<145::aid-ffj565>3.0.co;2-o - 11. Outgoing r'ship
FOUND_INto/from Eucalyptus Leucoxylon (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730100605 - 12. Outgoing r'ship
FOUND_INto/from Eucalyptus Melanophloia (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730100605 - 13. Outgoing r'ship
FOUND_INto/from Eucalyptus Melliodora (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 14. Outgoing r'ship
FOUND_INto/from Eucalyptus Moluccana (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 15. Outgoing r'ship
FOUND_INto/from Eucalyptus Sideroxylon (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 16. Outgoing r'ship
FOUND_INto/from Eucalyptus Staigeriana (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 17. Outgoing r'ship
FOUND_INto/from Eucalyptus Viridis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730100605 - 18. Outgoing r'ship
FOUND_INto/from Ficus Carica (Plant) Rel Props:Source_db:fooddb_chem_all - 19. Outgoing r'ship
FOUND_INto/from Hippophae Rhamnoides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Humulus Lupulus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all - 22. Outgoing r'ship
FOUND_INto/from Spondias Dulcis (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2001.9699686 - 23. Outgoing r'ship
FOUND_INto/from Valeriana Officinalis (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2015.1107512