[4]-Isogingerol
PubChem CID: 11482504
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | [4]-Isogingerol |
|---|---|
| Prediction Swissadme | 1.0 |
| Topological Polar Surface Area | 66.8 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | RGSRPNZPGBVHPU-UHFFFAOYSA-N |
| Fcsp3 | 0.5333333333333333 |
| Rotatable Bond Count | 8.0 |
| Heavy Atom Count | 19.0 |
| Compound Name | [4]-Isogingerol |
| Description | [4]-isogingerol is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. [4]-isogingerol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [4]-isogingerol can be found in ginger, which makes [4]-isogingerol a potential biomarker for the consumption of this food product. |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 266.152 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 266.152 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 267.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 266.33 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-hydroxy-8-(4-hydroxy-3-methoxyphenyl)octan-4-one |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Prediction Hob | 1.0 |
| Esol | -2.2553736105263154 |
| Inchi | InChI=1S/C15H22O4/c1-3-4-12(16)10-13(17)7-5-11-6-8-14(18)15(9-11)19-2/h6,8-9,13,17-18H,3-5,7,10H2,1-2H3 |
| Smiles | CCCC(=O)CC(CCC1=CC(=C(C=C1)O)OC)O |
| Xlogp | 1.4 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C15H22O4 |
- 1. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all