Oboflavanone B
PubChem CID: 11398788
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | oboflavanone B, ethyl 4-((1S,7R,13R,15R)-3-hydroxy-5-oxo-7-phenyl-13-((E)-2-phenylethenyl)-8,12,14-trioxatetracyclo(11.3.1.02,11.04,9)heptadeca-2,4(9),10-trien-15-yl)butanoate, Ethyl 4-((1S,7R,13R,15R)-3-hydroxy-5-oxo-7-phenyl-13-((e)-2-phenylethenyl)-8,14-dioxatetracyclo(11.3.1.0,.0,)heptadeca-2,4(9),10-trien-15-yl)butanoic acid, ethyl 4-[(1S,7R,13R,15R)-3-hydroxy-5-oxo-7-phenyl-13-[(E)-2-phenylethenyl]-8,12,14-trioxatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),10-trien-15-yl]butanoate, Ethyl 4-[(1S,7R,13R,15R)-3-hydroxy-5-oxo-7-phenyl-13-[(e)-2-phenylethenyl]-8,14-dioxatetracyclo[11.3.1.0,.0,]heptadeca-2,4(9),10-trien-15-yl]butanoic acid, CHEMBL504055, 712272-92-9 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 91.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC(C2CCCCC2)CC2CC3CC4(CCC5CCCCC5)CCCC(C4)C3CC12 |
| Np Classifier Class | Flavanones |
| Deep Smiles | CCOC=O)CCC[C@@H]C[C@H]C[C@]O6)/C=C/cccccc6))))))))Occ6cO)ccc6)O[C@H]CC6=O)))cccccc6 |
| Heavy Atom Count | 41.0 |
| Classyfire Class | Flavonoids |
| Scaffold Graph Node Level | OC1CC(C2CCCCC2)OC2CC3OC4(CCC5CCCCC5)CC(CCO4)C3CC12 |
| Classyfire Subclass | Pyranoflavonoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 937.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | ethyl 4-[(1S,7R,13R,15R)-3-hydroxy-5-oxo-7-phenyl-13-[(E)-2-phenylethenyl]-8,12,14-trioxatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),10-trien-15-yl]butanoate |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 6.3 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C34H34O7 |
| Scaffold Graph Node Bond Level | O=C1CC(c2ccccc2)Oc2cc3c(cc21)C1CCOC(C=Cc2ccccc2)(C1)O3 |
| Inchi Key | PBUGPZVNGOXMPZ-IOLYBBLISA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 9.0 |
| Synonyms | semecarpus biflavanone b |
| Esol Class | Poorly soluble |
| Functional Groups | COC(C)=O, c/C=C/[C@@](C)(Oc)OC, cC(C)=O, cO, cOC |
| Compound Name | Oboflavanone B |
| Exact Mass | 554.23 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 554.23 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 554.6 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C34H34O7/c1-2-38-30(36)15-9-14-25-18-24-21-34(40-25,17-16-22-10-5-3-6-11-22)41-29-20-28-32(33(37)31(24)29)26(35)19-27(39-28)23-12-7-4-8-13-23/h3-8,10-13,16-17,20,24-25,27,37H,2,9,14-15,18-19,21H2,1H3/b17-16+/t24-,25+,27+,34-/m0/s1 |
| Smiles | CCOC(=O)CCC[C@@H]1C[C@H]2C[C@@](O1)(OC3=CC4=C(C(=O)C[C@@H](O4)C5=CC=CC=C5)C(=C23)O)/C=C/C6=CC=CC=C6 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | False |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Actinodaphne Obovata (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Carapa Obovata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Cassia Obovata (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Charpentiera Obovata (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Cryptocarya Alba (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Cryptocarya Amygdalina (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Cryptocarya Aschersoniana (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Cryptocarya Bourdillonii (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Cryptocarya Chinensis (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Cryptocarya Infectoria (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Cryptocarya Lividula (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Cryptocarya Longifolia (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Cryptocarya Oblata (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Cryptocarya Triplinervis (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Cryptocarya Wightiana (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Finlaysonia Obovata (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Jungermannia Obovata (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Magnolia Obovata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Paeonia Obovata (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Picea Obovata (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Planchonella Obovata (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Semecarpus Anacardium (Plant) Rel Props:Reference:ISBN:9788185042114