1,5-Dimethylnaphthalene
PubChem CID: 11306
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1,5-DIMETHYLNAPHTHALENE, 571-61-9, Naphthalene, 1,5-dimethyl-, 1,5-DMN, 1,5-dimethyl-naphthalene, UNII-60CM3233U9, CHEBI:48608, EINECS 209-338-5, MFCD00004038, NSC 59388, NSC-59388, 60CM3233U9, CHEMBL435106, DTXSID0060351, NSC59388, 1,5-Dimethylnaphthalin, Naphthalene,5-dimethyl-, Naphthalene, 1,5dimethyl, Naphthalene,1,5-dimethyl-, 1,5-Dimethylnaphthalene, 98%, DTXCID5042166, Naphthalene, 1,5-dimethyl-(8CI), BDBM50159247, STL280252, AKOS005208625, AS-57959, Naphthalene, 1,5-dimethyl-(8CI)(9CI), CS-0147061, D0748, D2764, NS00033654, A12656, Q27121286, 209-338-5 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2CCCCC2C1 |
| Deep Smiles | Ccccccc6cccc6C |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Naphthalenes |
| Scaffold Graph Node Level | C1CCC2CCCCC2C1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 132.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P05177, P11509, P20852 |
| Iupac Name | 1,5-dimethylnaphthalene |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Target Id | NPT208, NPT240 |
| Xlogp | 4.4 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C12H12 |
| Scaffold Graph Node Bond Level | c1ccc2ccccc2c1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | SDDBCEWUYXVGCQ-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.1666666666666666 |
| Logs | -4.919 |
| Rotatable Bond Count | 0.0 |
| Logd | 3.799 |
| Synonyms | 1,5-dimethyl-naphthalene |
| Esol Class | Moderately soluble |
| Compound Name | 1,5-Dimethylnaphthalene |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 156.094 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 156.094 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 156.22 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.184680266666666 |
| Inchi | InChI=1S/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
| Smiles | CC1=C2C=CC=C(C2=CC=C1)C |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Buxus Microphylla (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Caragana Sinica (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Coriaria Sinica (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Ephedra Altissima (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Ephedra Aphylla (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Ephedra Distachya (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Ephedra Equisetina (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Ephedra Gerardiana (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Ephedra Herba (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Ephedra Intermedia (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Ephedra Lepidosperma (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Ephedra Likiangensis (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Ephedra Lomatolepis (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Ephedra Major (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Ephedra Minuta (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Ephedra Monosperma (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Ephedra Procera (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Ephedra Przewalskii (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Ephedra Regeliana (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Ephedra Saxatilis (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Ephedra Sinica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 22. Outgoing r'ship
FOUND_INto/from Radermachera Sinica (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Rheum Palmatum (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 24. Outgoing r'ship
FOUND_INto/from Rhodiola Kirilowii (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Salvia Sinica (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Stephania Sinica (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Tephroseris Kirilowii (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Trichosanthes Anaimalaienis (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Trichosanthes Anguina (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Trichosanthes Bracteata (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Trichosanthes Cordata (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Trichosanthes Cucumerina (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Trichosanthes Cucumeroides (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Trichosanthes Dioica (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Trichosanthes Ichiana (Plant) Rel Props:Reference: - 36. Outgoing r'ship
FOUND_INto/from Trichosanthes Kirilowii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 37. Outgoing r'ship
FOUND_INto/from Trichosanthes Laciniosa (Plant) Rel Props:Reference: - 38. Outgoing r'ship
FOUND_INto/from Trichosanthes Lepiniana (Plant) Rel Props:Reference: - 39. Outgoing r'ship
FOUND_INto/from Trichosanthes Lobata (Plant) Rel Props:Reference: - 40. Outgoing r'ship
FOUND_INto/from Trichosanthes Nervifolia (Plant) Rel Props:Reference: - 41. Outgoing r'ship
FOUND_INto/from Trichosanthes Palmata (Plant) Rel Props:Reference: - 42. Outgoing r'ship
FOUND_INto/from Trichosanthes Rosthornii (Plant) Rel Props:Reference: - 43. Outgoing r'ship
FOUND_INto/from Trichosanthes Tricuspidata (Plant) Rel Props:Reference: - 44. Outgoing r'ship
FOUND_INto/from Trichosanthes Wallichiana (Plant) Rel Props:Reference: