alpha-D-Fructofuranose
PubChem CID: 11105942
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | alpha-D-fructofuranose, 10489-79-9, .alpha.-D-Fructofuranose, levulose, 39H3P71QRA, (2S,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol, UNII-39H3P71QRA, CHEBI:37720, a-d-fructofuranose, Levulosa, Levulosa Baxter, Levulosa Braun, Apir Levulosa, Levulosa Ibys, Levulosa Mein, Levulosa Grifols, Levulosado Braun, Levulosa, Apir, Fleboplast Levulosa, Levulosa, Fleboplast, Plast Apyr Levulosa Mein, alpha-d-fructose, Z9N, Ern Brand of Fructose, Braun Brand of Fructose, I+/--D-Fructofuranose, Baxter Brand of Fructose, Bieffe Brand of Fructose, Grifols Brand of Fructose, SCHEMBL240001, CHEMBL4748482, Fresenius Kabi Brand of Fructose, DTXSID401315852, alpha-D-fructose, D-fructose, fructose, Instituto Farmacologico Brand of Fructose, C22502, Q27117237, (2S,3S,4S,5R)-2,5-Bis(hydroxymethyl)tetrahydrofuran-2,3,4-triol |
|---|---|
| Topological Polar Surface Area | 110.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 12.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 162.0 |
| Database Name | cmaup_ingredients;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (2S,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol |
| Prediction Hob | 0.0 |
| Xlogp | -2.3 |
| Molecular Formula | C6H12O6 |
| Prediction Swissadme | 0.0 |
| Inchi Key | RFSUNEUAIZKAJO-ZXXMMSQZSA-N |
| Fcsp3 | 1.0 |
| Logs | -0.243 |
| Rotatable Bond Count | 2.0 |
| Logd | -1.315 |
| Compound Name | alpha-D-Fructofuranose |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 180.063 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 180.063 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 180.16 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 0.6177328000000001 |
| Inchi | InChI=1S/C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3-5,7-11H,1-2H2/t3-,4-,5+,6+/m1/s1 |
| Smiles | C([C@@H]1[C@H]([C@@H]([C@@](O1)(CO)O)O)O)O |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Alisma Orientalis (Plant) Rel Props:Source_db:cmaup_ingredients