Ventiloquinone E
PubChem CID: 11013000
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | VENTILOQUINONE E, (1R,3S)-6,7,9-trimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo(g)isochromene-5,10-dione, (1R,3S)-6,7,9-trimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione, CHEMBL2269916 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 71.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1C2CCCCC2C(C)C2CCCCC12 |
| Np Classifier Class | Naphthoquinones |
| Deep Smiles | COcccOC))ccc6OC)))C=O)C=CC6=O))[C@@H]C)O[C@H]C6)C |
| Heavy Atom Count | 24.0 |
| Classyfire Class | Isochromanequinones |
| Scaffold Graph Node Level | OC1C2CCCCC2C(O)C2COCCC12 |
| Classyfire Subclass | Benzoisochromanequinones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 568.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (1R,3S)-6,7,9-trimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 1.9 |
| Is Pains | True |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H20O6 |
| Scaffold Graph Node Bond Level | O=C1C2=C(COCC2)C(=O)c2ccccc21 |
| Inchi Key | AIEBVACSHFUVDU-DTWKUNHWSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | ventiloquinone e |
| Esol Class | Soluble |
| Functional Groups | CC1=C(C)C(=O)ccC1=O, COC, cOC |
| Compound Name | Ventiloquinone E |
| Exact Mass | 332.126 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 332.126 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 332.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C18H20O6/c1-8-6-10-13(9(2)24-8)17(20)14-11(21-3)7-12(22-4)18(23-5)15(14)16(10)19/h7-9H,6H2,1-5H3/t8-,9+/m0/s1 |
| Smiles | C[C@H]1CC2=C([C@H](O1)C)C(=O)C3=C(C2=O)C(=C(C=C3OC)OC)OC |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Naphthalenes |
- 1. Outgoing r'ship
FOUND_INto/from Abies Alba (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Abies Balsamea (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Abies Bifolia (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Abies Canadensis (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Abies Densa (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Abies Excelsa (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Abies Grandis (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Abies Koreana (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Abies Nephrolepis (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Abies Nigra (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Abies Nobilis (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Abies Pindrow (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Abies Pinsapo (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Abies Spectabilis (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Abies Veitchii (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Abies Webbiana (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Artemisia Pectinata (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Humata Pectinata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Hyptis Pectinata (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Pedicularis Pectinata (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Picea Abies (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Rungia Pectinata (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Santolina Pectinata (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Ventilago Maderaspatana (Plant) Rel Props:Reference:ISBN:9788185042138 - 25. Outgoing r'ship
FOUND_INto/from Veronica Pectinata (Plant) Rel Props:Reference: