Dulcinol
PubChem CID: 10993579
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | dulcinol, [(1S,2S,6R,7R,8R,10S,13S)-6-(hydroxymethyl)-2,6,13-trimethyl-12-oxo-8-tetracyclo[11.2.1.01,10.02,7]hexadecanyl] benzoate, ((1S,2S,6R,7R,8R,10S,13S)-6-(hydroxymethyl)-2,6,13-trimethyl-12-oxo-8-tetracyclo(11.2.1.01,10.02,7)hexadecanyl) benzoate, (1R,2S,6R,7R,8R,10R,13R)-6-(Hydroxymethyl)-2,13-dimethyl-12-oxotetracyclo(11.2.1.0,.0,)hexadecan-8-yl benzoic acid, (1R,2S,6R,7R,8R,10R,13R)-6-(Hydroxymethyl)-2,13-dimethyl-12-oxotetracyclo[11.2.1.0,.0,]hexadecan-8-yl benzoic acid, 130838-01-6 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 63.6 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CC1CC2CC(C)C3CCC2(C3)C2CCCCC12)C1CCCCC1 |
| Np Classifier Class | Podocarpane diterpenoids |
| Deep Smiles | OC[C@]C)CCC[C@][C@H]6[C@H]OC=O)cccccc6))))))))C[C@@H][C@@]6CC[C@@]C5)C=O)C7))C)))))))))C |
| Heavy Atom Count | 31.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CC2CC(OC(O)C3CCCCC3)C3CCCCC3C23CCC1C3 |
| Classyfire Subclass | Diterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 756.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 7.0 |
| Iupac Name | [(1S,2S,6R,7R,8R,10S,13S)-6-(hydroxymethyl)-2,6,13-trimethyl-12-oxo-8-tetracyclo[11.2.1.01,10.02,7]hexadecanyl] benzoate |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 5.3 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C27H36O4 |
| Scaffold Graph Node Bond Level | O=C(OC1CC2CC(=O)C3CCC2(C3)C2CCCCC12)c1ccccc1 |
| Inchi Key | CFPMRJFTBKYCRR-FOOPCEIZSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | dulcinol |
| Esol Class | Moderately soluble |
| Functional Groups | CC(C)=O, CO, cC(=O)OC |
| Compound Name | Dulcinol |
| Exact Mass | 424.261 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 424.261 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 424.6 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 7.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C27H36O4/c1-24-12-13-27(16-24)19(15-21(24)29)14-20(31-23(30)18-8-5-4-6-9-18)22-25(2,17-28)10-7-11-26(22,27)3/h4-6,8-9,19-20,22,28H,7,10-17H2,1-3H3/t19-,20+,22-,24-,25-,26-,27-/m0/s1 |
| Smiles | C[C@]12CC[C@]3(C1)[C@@H](C[C@H]([C@@H]4[C@@]3(CCC[C@@]4(C)CO)C)OC(=O)C5=CC=CC=C5)CC2=O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Scoparia Dulcis (Plant) Rel Props:Reference:ISBN:9788172361792; ISBN:9788172363093; ISBN:9788185042145