D-Ribose
PubChem CID: 10975657
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D-ribose, D-ribopyranose, ribose, Ribopyranose, D-Rib, ribopyranoside, d-ribopyranoside, RIB, 10257-32-6, D Ribose, (3R,4R,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetraol, (3R,4R,5R)-Oxane-2,3,4,5-tetrol, Ribopyranose (7CI,8CI,9CI), 10257-33-7, (3R,4R,5R)-tetrahydro-2H-pyran-2,3,4,5-tetrol, Ribiose, ribo-pentose, D-ribo-pentose, EC 700-481-3, Ribopyranose(7ci,8ci,9ci), SCHEMBL339948, CHEBI:16988, CHEBI:33942, CHEBI:47006, CHEBI:47007, DTXSID70450356, SRBFZHDQGSBBOR-SOOFDHNKSA-N, NS00106195, C21057, EN300-1704373, Q27120754, rel-(3R,4R,5R)-tetrahydro-2H-pyran-2,3,4,5-tetrol, 200-059-4 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 90.2 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Monosaccharides |
| Deep Smiles | O[C@@H]COC[C@@H][C@@H]6O))O))O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | C1CCOCC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 117.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (3R,4R,5R)-oxane-2,3,4,5-tetrol |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -2.5 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H10O5 |
| Scaffold Graph Node Bond Level | C1CCOCC1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | SRBFZHDQGSBBOR-SOOFDHNKSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 1.0 |
| Logs | -0.057 |
| Rotatable Bond Count | 0.0 |
| Logd | -2.256 |
| Synonyms | ribose |
| Esol Class | Highly soluble |
| Functional Groups | CO, COC(C)O |
| Compound Name | D-Ribose |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 150.053 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 150.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 150.13 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | 1.1317940000000002 |
| Inchi | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4-,5?/m1/s1 |
| Smiles | C1[C@H]([C@H]([C@H](C(O1)O)O)O)O |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Reference:ISBN:9780896038776; ISBN:9788172362140; ISBN:9788185042053 - 2. Outgoing r'ship
FOUND_INto/from Alternanthera Philoxeroides (Plant) Rel Props:Reference:ISBN:9770972795006 - 3. Outgoing r'ship
FOUND_INto/from Artemisia Nilagirica (Plant) Rel Props:Reference:ISBN:9788185042114 - 4. Outgoing r'ship
FOUND_INto/from Heterophragma Quadriloculare (Plant) Rel Props:Reference:ISBN:9788185042138 - 5. Outgoing r'ship
FOUND_INto/from Phoenix Dactylifera (Plant) Rel Props:Reference:ISBN:9780387706375 - 6. Outgoing r'ship
FOUND_INto/from Pogostemon Auricularius (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Pogostemon Benghalense (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Pogostemon Benghalensis (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Pogostemon Cablin (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Pogostemon Heyneanus (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Pogostemon Paniculatus (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Pogostemon Parviflorus (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Pogostemon Patchouli (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Pogostemon Plectranthoides (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Pogostemon Pubescens (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Pogostemon Purpurascens (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Pogostemon Rugosus (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Pogostemon Stellatus (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Pogostemon Vestitus (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Rubia Akane (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Rubia Cordifolia (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Rubia Manjith (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Rubia Oncotricha (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Rubia Schumanniana (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Rubia Sikkimensis (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Rubia Tetragona (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Rubia Tinctorum (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Rubia Ustulata (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Rubia Wallichiana (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Rubia Yunnanensis (Plant) Rel Props:Reference: