Turmeronol B
PubChem CID: 10955433
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Turmeronol B, 2-Hepten-4-one, 6-(2-hydroxy-4-methylphenyl)-2-methyl-, (+)-Turmeronol B, 139085-15-7, 6-(2-Hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one, DTXSID20449715, 6-(2-Hydroxy-4-methylphenyl)-2-methyl-2-hepten-4-one, SCHEMBL6422167, DTXCID50400536 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Bisabolane sesquiterpenoids |
| Deep Smiles | CC=CC=O)CCcccccc6O)))C)))))C)))))C |
| Heavy Atom Count | 17.0 |
| Classyfire Class | Prenol lipids |
| Description | Constituent of turmeric (Curcuma longa). Turmeronol B is found in turmeric and herbs and spices. |
| Scaffold Graph Node Level | C1CCCCC1 |
| Classyfire Subclass | Sesquiterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 289.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-(2-hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.9 |
| Superclass | Lipids and lipid-like molecules |
| Subclass | Sesquiterpenoids |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H20O2 |
| Scaffold Graph Node Bond Level | c1ccccc1 |
| Inchi Key | WYIJOOQDLOBLCP-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | (+)-Turmeronol B, Turmeronol B, 6-(2-Hydroxy-4-methylphenyl)-2-methyl-2-hepten-4-one, (+)-Turmeronol b, turmeronol b |
| Esol Class | Soluble |
| Functional Groups | CC(=O)C=C(C)C, cO |
| Compound Name | Turmeronol B |
| Kingdom | Organic compounds |
| Exact Mass | 232.146 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 232.146 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 232.32 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H20O2/c1-10(2)7-13(16)9-12(4)14-6-5-11(3)8-15(14)17/h5-8,12,17H,9H2,1-4H3 |
| Smiles | CC1=CC(=C(C=C1)C(C)CC(=O)C=C(C)C)O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Sesquiterpenoids |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Curcuma Longa (Plant) Rel Props:Source_db:fooddb_chem_all