(1R,3S)-9,10-dihydroxy-1,3,8-trimethyl-3,4-dihydro-1H-benzo[g]isochromene-6,7-dione
PubChem CID: 10946123
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | True |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 83.8 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCC(C)C2CC3CCCCC3CC12 |
| Np Classifier Class | Naphthoquinones |
| Deep Smiles | C[C@@H]O[C@H]C)ccC6)cccc6O))C=O)C=CC6=O))O))C |
| Heavy Atom Count | 21.0 |
| Classyfire Class | Isochromanequinones |
| Scaffold Graph Node Level | OC1CCC(O)C2CC3COCCC3CC12 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 523.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (1R,3S)-9,10-dihydroxy-1,3,8-trimethyl-3,4-dihydro-1H-benzo[g]isochromene-6,7-dione |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 1.9 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C16H16O5 |
| Scaffold Graph Node Bond Level | O=C1C=CC(=O)c2cc3c(cc21)CCOC3 |
| Inchi Key | SCCBRHYDNPEMCG-POYBYMJQSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | ventilagone |
| Esol Class | Soluble |
| Functional Groups | CC1=C(O)C(=O)ccC1=O, COC, cO |
| Compound Name | (1R,3S)-9,10-dihydroxy-1,3,8-trimethyl-3,4-dihydro-1H-benzo[g]isochromene-6,7-dione |
| Exact Mass | 288.1 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 288.1 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 288.29 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C16H16O5/c1-6-4-9-5-10-12(16(20)11(9)8(3)21-6)13(17)7(2)14(18)15(10)19/h5-6,8,17,20H,4H2,1-3H3/t6-,8+/m0/s1 |
| Smiles | C[C@H]1CC2=CC3=C(C(=C(C(=O)C3=O)C)O)C(=C2[C@H](O1)C)O |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Naphthalenes |
- 1. Outgoing r'ship
FOUND_INto/from Ventilago Denticulata (Plant) Rel Props:Reference:ISBN:9788172360818