2,4-Dimethylthiazole
PubChem CID: 10934
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,4-DIMETHYLTHIAZOLE, 541-58-2, 2,4-Dimethyl-1,3-thiazole, Thiazole, 2,4-dimethyl-, 2,4-Methylthiazole, 2,4-dimethyl-thiazole, NSC 7510, EINECS 208-786-9, UNII-LHT97038OA, BRN 0106414, LHT97038OA, 2,4-dimethyl thiazole, NSC-7510, MFCD00014509, DTXSID2060250, 4-27-00-00981 (Beilstein Handbook Reference), dimethylthiazol, 2,4-Dimethyl-1,3-thiazole, 2,4-Methylthiazole, NSC 7510, NSC7510, 2,4 dimethylthiazole, 2.4-dimethylthiazole, Thiazole,4-dimethyl-, 2, 4-Dimethylthiazole, SCHEMBL128316, DTXCID2041597, WLN: T5N CSJ B1 E1, 2,4-Dimethyl-1,3-thiazole #, CHEBI:193946, 2,4-Dimethylthiazole, >=95%, FG, AKOS000121561, CS-W013648, BP-10584, DB-020001, D1220, NS00022342, EN300-16084, O10604, A830001, Q27282995, Z48850603, 208-786-9 |
|---|---|
| Topological Polar Surface Area | 41.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | OBSLLHNATPQFMJ-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| Synonyms | 2, 4-Dimethylthiazole, 2,4-Dimethyl-1,3-thiazole, 2,4-Dimethyl-thiazole, 2,4-Methylthiazole, Thiazole, 2,4-dimethyl- |
| Heavy Atom Count | 7.0 |
| Compound Name | 2,4-Dimethylthiazole |
| Kingdom | Organic compounds |
| Description | Constituent of beef aroma. 2,4-Dimethylthiazole is found in tea and animal foods. |
| Exact Mass | 113.03 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 113.03 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 65.099 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 113.18 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,4-dimethyl-1,3-thiazole |
| Total Atom Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Azoles |
| Inchi | InChI=1S/C5H7NS/c1-4-3-7-5(2)6-4/h3H,1-2H3 |
| Smiles | CC1=CSC(=N1)C |
| Xlogp | 1.8 |
| Superclass | Organoheterocyclic compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Thiazoles |
| Taxonomy Direct Parent | 2,4-disubstituted thiazoles |
| Molecular Formula | C5H7NS |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all