Prolycopene
PubChem CID: 10918539
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | prolycopene, 7,9,7',9'-tetracis-lycopene, 7,7',9,9'-tetra-cis-lycopene, (6E,8Z,10Z,12E,14E,16E,18E,20E,22Z,24Z,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene, 2361-24-2, CHEBI:62466, 7,9,7',9'-Tetra-cis-lycopene, (7Z,9Z,7'Z,9'Z)-xi,xi-carotene, 7-cis,7'-cis,9-cis,9'-cis-psi,psi-carotene, All trans Lycopene, Neolycopene, Pro Lycopene, Pro-Lycopene, tetra-cis-lycopene, (7Z,7'z,9Z,9'z)-Lycopene, 7,9,9',7'-tetra-cis-lycopene, DTXSID001318123, (7Z,9Z,7'Z,9'Z)-Lycopene, 7-cis,9-cis,7'-cis,9'-cis-Lycopene, (7-cis,7'-cis,9-cis,9'-cis)-Psi,psi-carotene, lycopene, (7-cis,7'-cis,9-cis,9'-cis)-isomer, Lycopene, (7-cis,7'-cis,9-cis,9'-cis)-isomer-, Q27131930 |
|---|---|
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | OAIJSZIZWZSQBC-BYUNHUQQSA-N |
| Rotatable Bond Count | 16.0 |
| State | Solid |
| Synonyms | (7Z,9Z,7'Z,9'z)-XI,XI-carotene, 7,7',9,9'-Tetra-cis-lycopene, 7,9,7',9'-Tetracis-lycopene, Prolycopene, Tetra-cis-lycopene, 7,9,7',9'-Tetra-cis-lycopene, Lycopene, Lycopene, (cis)-isomer, Lycopene, (7-cis,7'-cis,9-cis,9'-cis)-isomer, (7-cis,7'-cis,9-cis,9'-cis)-psi,psi-Carotene, (7-cis,7'-cis,9-cis,9'-cis)-ψ,ψ-Carotene, (7-cis,7’-cis,9-cis,9’-cis)-ψ,ψ-Carotene, (7Z,7'Z,9Z,9'Z)-Lycopene, (7Z,7’Z,9Z,9’Z)-Lycopene, 7-cis,9-cis,7'-cis,9'-cis-Lycopene, 7-cis,9-cis,7’-cis,9’-cis-Lycopene, LYCOMATO, LYC O mato, Pro-lycopene, all trans Lycopene, Pro lycopene |
| Heavy Atom Count | 40.0 |
| Compound Name | Prolycopene |
| Kingdom | Organic compounds |
| Description | Constituent of tomatoes (Lycopersicon esculentum)and is) also in other fruits. Prolycopene is found in many foods, some of which are date, oriental wheat, grapefruit/pummelo hybrid, and banana. |
| Exact Mass | 536.438 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 536.438 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1050.0 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 536.9 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (6E,8Z,10Z,12E,14E,16E,18E,20E,22Z,24Z,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene |
| Total Atom Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Total Bond Stereocenter Count | 11.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17-,32-18-,35-21+,36-22+,37-27+,38-28+,39-29-,40-30- |
| Smiles | CC(=CCC/C(=C/C=C\C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(\C=C/C=C(/CCC=C(C)C)\C)/C)\C)/C)\C)/C)C |
| Xlogp | 15.6 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 11.0 |
| Subclass | Tetraterpenoids |
| Taxonomy Direct Parent | Carotenes |
| Molecular Formula | C40H56 |
- 1. Outgoing r'ship
FOUND_INto/from Lycopersicon Esculentum (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Passiflora Edulis (Plant) Rel Props:Source_db:fooddb_chem_all