5,11-Selinadiene
PubChem CID: 10899741
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5,11-Selinadiene |
|---|---|
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | MOTCYZHGMCNNRH-UKRRQHHQSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | Selina-5,11-diene |
| Heavy Atom Count | 15.0 |
| Compound Name | 5,11-Selinadiene |
| Description | 5,11-selinadiene is a member of the class of compounds known as eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids. Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids are sesquiterpenoids with a structure based on the eudesmane skeleton. 5,11-selinadiene can be found in common sage, which makes 5,11-selinadiene a potential biomarker for the consumption of this food product. |
| Exact Mass | 204.188 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 204.188 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 308.0 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 204.35 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2R,4aR)-4a,8-dimethyl-2-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
| Total Atom Stereocenter Count | 2.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13H,1,5-10H2,2-4H3/t13-,15-/m1/s1 |
| Smiles | CC1=C2C[C@@H](CC[C@]2(CCC1)C)C(=C)C |
| Xlogp | 4.9 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C15H24 |
- 1. Outgoing r'ship
FOUND_INto/from Salvia Officinalis (Plant) Rel Props:Source_db:fooddb_chem_all