Dihydroretrofractamide B
PubChem CID: 10893678
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dihydroretrofractamide B, 10,11-Dihydropipercide, SCHEMBL11305653, SCHEMBL11307682, CHEBI:174786, DTXSID601149493, 75022-26-3, (2E,4E)-11-(1,3-Benzodioxol-5-yl)-N-(2-methylpropyl)-2,4-undecadienamide, (2E,4E)-11-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)undeca-2,4-dienamide, (2E,4E)-11-(2H-1,3-BENZODIOXOL-5-YL)-N-(2-METHYLPROPYL)UNDECA-2,4-DIENAMIDE |
|---|---|
| Topological Polar Surface Area | 47.6 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | DMIKQRDDTCGOLE-VTKKNFPDSA-N |
| Rotatable Bond Count | 11.0 |
| Synonyms | 10,11-Dihydropipercide, Dihydroretrofractamide B |
| Heavy Atom Count | 26.0 |
| Compound Name | Dihydroretrofractamide B |
| Description | Alkaloid from the fruit of Piper nigrum (pepper). Dihydroretrofractamide B is found in herbs and spices and pepper (spice). |
| Exact Mass | 357.23 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 357.23 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 458.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 357.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2E,4E)-11-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)undeca-2,4-dienamide |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 2.0 |
| Inchi | InChI=1S/C22H31NO3/c1-18(2)16-23-22(24)12-10-8-6-4-3-5-7-9-11-19-13-14-20-21(15-19)26-17-25-20/h6,8,10,12-15,18H,3-5,7,9,11,16-17H2,1-2H3,(H,23,24)/b8-6+,12-10+ |
| Smiles | CC(C)CNC(=O)/C=C/C=C/CCCCCCC1=CC2=C(C=C1)OCO2 |
| Xlogp | 6.2 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 2.0 |
| Molecular Formula | C22H31NO3 |
- 1. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all