D-Olivose
PubChem CID: 10888063
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D-olivose, Olivose, D-Oli, 2,6-Dideoxy-Arabinose, 2,6-Dideoxy-D-Arabino-Hexopyranose, 2,6-Dideoxy-D-Arabinose, 2,6-Dideoxy-Arabinopyranose, 2,6-Dideoxy-Arabinopyranoside, 2,6-Dideoxy-D-Arabinopyranose, 2,6-Dideoxy-D-Arabinopyranoside, 2,6-Dideoxy-Arabino-Hexopyranose, OLI, D-Canarose, 2-deoxy-D-rhamnose, SCHEMBL9542066, DTXCID70142648, CHEBI:139377, C21054 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 69.9 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Monosaccharides |
| Deep Smiles | OCC[C@@H]O)[C@@H][C@H]O6)C))O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | C1CCOCC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 116.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (4R,5S,6R)-6-methyloxane-2,4,5-triol |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -1.1 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H12O4 |
| Scaffold Graph Node Bond Level | C1CCOCC1 |
| Inchi Key | FDWRIIDFYSUTDP-DUVQVXGLSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | d-canarose |
| Esol Class | Very soluble |
| Functional Groups | CC(O)OC, CO |
| Compound Name | D-Olivose |
| Exact Mass | 148.074 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 148.074 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 148.16 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C6H12O4/c1-3-6(9)4(7)2-5(8)10-3/h3-9H,2H2,1H3/t3-,4-,5?,6-/m1/s1 |
| Smiles | C[C@@H]1[C@H]([C@@H](CC(O1)O)O)O |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Marsdenia Tenacissima (Plant) Rel Props:Reference:ISBN:9788171360536