Balsaminone B
PubChem CID: 10815442
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | BALSAMINONE B, 21-Methoxy-20-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18,20-nonaene-3,10-dione, 21-methoxy-20-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)oxy-12-oxapentacyclo(11.8.0.02,11.04,9.014,19)henicosa-1(13),2(11),4,6,8,14,16,18,20-nonaene-3,10-dione, CHEMBL463739, 213271-56-8, 5-beta-D-Glucosyloxy-6-methoxydinaphtho(1,2-b-2',3'-D)furan-7,12-dione |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 156.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1C2CCCCC2C(C)C2C1CC1C3CCCCC3C(CC3CCCCC3)CC12 |
| Deep Smiles | OC[C@H]O[C@@H]OccOC))ccC=O)cccccc6C=O)c%10oc%13cc%17cccc6))))))))))))))))))))))[C@@H][C@H][C@@H]6O))O))O |
| Heavy Atom Count | 37.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | OC1C2CCCCC2C(O)C2C3CC(OC4CCCCO4)C4CCCCC4C3OC12 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 881.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | 21-methoxy-20-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18,20-nonaene-3,10-dione |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | 2.7 |
| Is Pains | True |
| Gsk 4 400 Rule | False |
| Molecular Formula | C27H22O10 |
| Scaffold Graph Node Bond Level | O=C1c2ccccc2C(=O)c2c1oc1c2cc(OC2CCCCO2)c2ccccc21 |
| Prediction Swissadme | 0.0 |
| Inchi Key | NAVQPSCNRHEZLY-FPISNOLNSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.2592592592592592 |
| Rotatable Bond Count | 4.0 |
| Synonyms | balsaminone-b |
| Esol Class | Moderately soluble |
| Functional Groups | CO, cC(c)=O, cOC, cO[C@@H](C)OC, coc |
| Compound Name | Balsaminone B |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 506.121 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 506.121 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 506.5 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.778170600000001 |
| Inchi | InChI=1S/C27H22O10/c1-34-26-17-16-18(29)11-6-2-3-7-12(11)19(30)25(16)36-23(17)13-8-4-5-9-14(13)24(26)37-27-22(33)21(32)20(31)15(10-28)35-27/h2-9,15,20-22,27-28,31-33H,10H2,1H3/t15-,20-,21+,22-,27+/m1/s1 |
| Smiles | COC1=C(C2=CC=CC=C2C3=C1C4=C(O3)C(=O)C5=CC=CC=C5C4=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Naphthalenes |
- 1. Outgoing r'ship
FOUND_INto/from Cardamine Impatiens (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Impatiens Angustifolia (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Impatiens Balsamina (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Impatiens Bicolor (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Impatiens Chinensis (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Impatiens Edgeworthii (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Impatiens Gigantea (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Impatiens Glandulifera (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Impatiens Latifolia (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Impatiens Minor (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Impatiens Pulcherrima (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Impatiens Scabrida (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Impatiens Siculifer (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Impatiens Trilobata (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Impatiens Tripetala (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Momordica Balsamina (Plant) Rel Props:Reference: