Madecassol
PubChem CID: 108062
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Asiaticoside, Madecassol, 16830-15-2, Ba 2742, [6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] 10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate, Urs-12-en-28-oic acid, 2,3,23-trihydroxy-, O-6-deoxy-alpha-L-mannopyranosyl-(1-->4)-O-beta-D-glucopyranosyl-(1-->6)-beta-D-glucopyranosyl ester, (2alpha,3beta,4alpha)-, Blastostimulina, Marticassol, SCHEMBL664796, WYQVAPGDARQUBT-UHFFFAOYSA-N, NSC166062, AKOS015960549, AC-6028, FK 1080, AS-75237, DB-064684, B0005-465086, [6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl)oxy-tetrahydropyran-2-yl]oxymethyl]-3,4,5-trihydroxy-tetrahydropyran-2-yl] 10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate, 6-({[3,4-DIHYDROXY-6-(HYDROXYMETHYL)-5-[(3,4,5-TRIHYDROXY-6-METHYLOXAN-2-YL)OXY]OXAN-2-YL]OXY}METHYL)-3,4,5-TRIHYDROXYOXAN-2-YL 10,11-DIHYDROXY-9-(HYDROXYMETHYL)-1,2,6A,6B,9,12A-HEXAMETHYL-2,3,4,5,6,7,8,8A,10,11,12,12B,13,14B-TETRADECAHYDRO-1H-PICENE-4A-CARBOXYLATE, Urs-12-en-28-oic acid,3,23-trihydroxy-, O-6-deoxy-.alpha.-L-mannopyranosyl-(1.fwdarw.4)-O-.beta.-D-glucopyranosyl-(1.fwdarw.6)-.beta.-D-glucopyranosyl ester, (2.alpha.,3.beta.,4.alpha.)- |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 315.0 |
| Hydrogen Bond Donor Count | 12.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CC1CCCC(CCC2CCC(CC3CCCCC3)CC2)C1)C12CCCCC1C1CCC3C4CCCCC4CCC3C1CC2 |
| Np Classifier Class | Ursane and Taraxastane triterpenoids |
| Deep Smiles | OCCOCOCCOCOC=O)CCCCCC6C=CCCCC6CC%14))C))C)CCCC6C)CCCC6C)CO)))O))O)))))))))))))C))C)))))))CCC6O))O))O)))))))CCC6OCOCC)CCC6O))O))O)))))))O))O |
| Heavy Atom Count | 67.0 |
| Classyfire Class | Prenol lipids |
| Description | Constituent of Centella asiatica (Asiatic pennywort). Asiaticoside is found in herbs and spices and green vegetables. |
| Scaffold Graph Node Level | OC(OC1CCCC(COC2CCC(OC3CCCCO3)CO2)O1)C12CCCCC1C1CCC3C4CCCCC4CCC3C1CC2 |
| Classyfire Subclass | Terpene glycosides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1820.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] 10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Prenol lipids |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 0.1 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Terpene glycosides |
| Gsk 4 400 Rule | False |
| Molecular Formula | C48H78O19 |
| Scaffold Graph Node Bond Level | O=C(OC1CCCC(COC2CCC(OC3CCCCO3)CO2)O1)C12CCCCC1C1=CCC3C4CCCCC4CCC3C1CC2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | WYQVAPGDARQUBT-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.9375 |
| Logs | -3.302 |
| Rotatable Bond Count | 10.0 |
| State | Solid |
| Logd | 2.543 |
| Synonyms | Asiaticosid, Asiaticoside, Blastoestimulina, Blastostimulina, Centelase, Dermatologico, Emdecassol, FK 1080, Madecassol, Marticassol, 6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl 10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid, asiaticoside |
| Esol Class | Moderately soluble |
| Functional Groups | CC=C(C)C, CO, COC(C)OC, COC(C)OC(C)=O |
| Compound Name | Madecassol |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 958.514 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 958.514 |
| Hydrogen Bond Acceptor Count | 19.0 |
| Molecular Weight | 959.1 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 27.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | False |
| Esol | -5.1896246000000055 |
| Inchi | InChI=1S/C48H78O19/c1-20-10-13-48(15-14-46(6)23(29(48)21(20)2)8-9-28-44(4)16-24(51)39(60)45(5,19-50)27(44)11-12-47(28,46)7)43(61)67-42-36(58)33(55)31(53)26(65-42)18-62-40-37(59)34(56)38(25(17-49)64-40)66-41-35(57)32(54)30(52)22(3)63-41/h8,20-22,24-42,49-60H,9-19H2,1-7H3 |
| Smiles | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)CO)O)O)C)C)C2C1C)C)C(=O)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)O)O)O)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Triterpene saponins |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Barringtonia Asiatica (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Berberis Asiatica (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Buddleja Asiatica (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Centella Asiatica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Chomelia Asiatica (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Colubrina Asiatica (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Gmelina Asiatica (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Grewia Asiatica (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Leea Asiatica (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Malus Asiatica (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Plantago Asiatica (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Striga Asiatica (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Tarenna Asiatica (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Tetracera Asiatica (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Toddalia Asiatica (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Torenia Asiatica (Plant) Rel Props:Reference: