Santene
PubChem CID: 10720
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | SANTENE, Santen, 2,3-Dimethylbicyclo[2.2.1]hept-2-ene, 529-16-8, 2,3-dimethyl-2-norbornene, 2-Norbornene, 2,3-dimethyl-, 2,3-Dimethylbicyclo(2.2.1)hept-2-ene, 2,3-dimethyl-bicyclo[2.2.1]hept-2-ene, 2,3-Dimethyl-Bicyclo(2.2.1)hept-2-ene, Bicyclo(2.2.1)hept-2-ene, 2,3-dimethyl-, Bicyclo[2.2.1]hept-2-ene, 2,3-dimethyl-, dimethylnorbornene, DTXSID20870585, CHEBI:184421, ALBB-035088, SANTENE, 2,3-dimethyl-2-Norbornene, AKOS040766691, 2,3-dimethylbicyclo[2.2.1]-2-heptene, 2,3-dimethylbicyclo[2.2.1]-hept-2-ene, 2,3-Dimethylbicyclo[2.2.1]hept-2-ene # |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CCC1C2 |
| Np Classifier Class | Menthane monoterpenoids |
| Deep Smiles | CC=CC)CCC5CC5 |
| Heavy Atom Count | 9.0 |
| Classyfire Class | Unsaturated hydrocarbons |
| Description | Flavouring ingredient. Constituent of sandalwood oil. Santene is found in cornmint, parsley, and rosemary. |
| Scaffold Graph Node Level | C1CC2CCC1C2 |
| Classyfire Subclass | Branched unsaturated hydrocarbons |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 147.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,3-dimethylbicyclo[2.2.1]hept-2-ene |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Unsaturated hydrocarbons |
| Veber Rule | True |
| Classyfire Superclass | Hydrocarbons |
| Xlogp | 2.2 |
| Superclass | Hydrocarbons |
| Is Pains | False |
| Subclass | Branched unsaturated hydrocarbons |
| Gsk 4 400 Rule | True |
| Molecular Formula | C9H14 |
| Scaffold Graph Node Bond Level | C1=CC2CCC1C2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | LSIXBBPOJBJQHN-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.7777777777777778 |
| Rotatable Bond Count | 0.0 |
| Synonyms | 2-Norbornene, 2,3-dimethyl-, 2,3-Dimethyl-2-norbornene, 2,3-Dimethyl-bicyclo(2.2.1)hept-2-ene, 2,3-Dimethyl-bicyclo[2.2.1]hept-2-ene, 2,3-Dimethylbicyclo(2.2.1)hept-2-ene, Bicyclo(2.2.1)hept-2-ene, 2,3-dimethyl-, Bicyclo[2.2.1]hept-2-ene, 2,3-dimethyl-, Santen, Santene, 2,3-dimethylbicyclo(2.2.1)Hept-2-ene, santene |
| Esol Class | Very soluble |
| Functional Groups | CC(C)=C(C)C |
| Compound Name | Santene |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 122.11 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 122.11 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 122.21 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -1.9774082 |
| Inchi | InChI=1S/C9H14/c1-6-7(2)9-4-3-8(6)5-9/h8-9H,3-5H2,1-2H3 |
| Smiles | CC1=C(C2CCC1C2)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Branched unsaturated hydrocarbons |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Abies Alba (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730020402 - 2. Outgoing r'ship
FOUND_INto/from Abies Balsamea (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730020402 - 3. Outgoing r'ship
FOUND_INto/from Aster Ageratoides (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2008.9699408 - 4. Outgoing r'ship
FOUND_INto/from Bupleurum Falcatum (Plant) Rel Props:Reference:ISBN:9788185042114 - 5. Outgoing r'ship
FOUND_INto/from Cedrus Deodara (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.764194 - 6. Outgoing r'ship
FOUND_INto/from Chaerophyllum Reflexum (Plant) Rel Props:Reference:ISBN:9788185042114 - 7. Outgoing r'ship
FOUND_INto/from Cupressus Macrocarpa (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2007.10643573 - 8. Outgoing r'ship
FOUND_INto/from Cymbopogon Martini (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2017.1341344 - 9. Outgoing r'ship
FOUND_INto/from Mentha Arvensis (Plant) Rel Props:Source_db:fooddb_chem_all - 10. Outgoing r'ship
FOUND_INto/from Mentha Rotundifolia (Plant) Rel Props:Source_db:npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Peucedanum Officinale (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2009.9700128 - 13. Outgoing r'ship
FOUND_INto/from Picea Abies (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730020402 - 14. Outgoing r'ship
FOUND_INto/from Pinus Massoniana (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1997.9700759 - 15. Outgoing r'ship
FOUND_INto/from Pinus Merkusii (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1609 - 16. Outgoing r'ship
FOUND_INto/from Pinus Pinaster (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730020402 - 17. Outgoing r'ship
FOUND_INto/from Pinus Sylvestris (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1998.9700928 - 18. Outgoing r'ship
FOUND_INto/from Pinus Wallichiana (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2015.1038090 - 19. Outgoing r'ship
FOUND_INto/from Pseudotsuga Menziesii (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730020402 - 20. Outgoing r'ship
FOUND_INto/from Rosmarinus Officinalis (Plant) Rel Props:Source_db:fooddb_chem_all - 21. Outgoing r'ship
FOUND_INto/from Santalum Album (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 22. Outgoing r'ship
FOUND_INto/from Tagetes Minuta (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1995.9698544 - 23. Outgoing r'ship
FOUND_INto/from Tetraclinis Articulata (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2015.1076739