Pyridoxine 5'-phosphate
PubChem CID: 1055
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Pyridoxine phosphate, 447-05-2, Pyridoxine 5-phosphate, pyridoxine-5'-phosphate, PYRIDOXINE 5'-PHOSPHATE, Pyridoxol 5-phosphate, Pyridoxyl-5-phosphate, 5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridylmethyl dihydrogen phosphate, Pyridoxol 5'-phosphate, pyridoxine-P, UNII-RG20W8WYLS, pyridoxine-5P, EINECS 207-179-6, NSC 83119, pyridoxine-phosphate, [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl dihydrogen phosphate, BRN 0233737, Pyridoxol, 5-(dihydrogen phosphate), NSC-83119, RG20W8WYLS, CHEBI:28803, DTXSID80196278, 4-21-00-02516 (Beilstein Handbook Reference), pyridoxine 5'-(dihydrogen phosphate), PYRIDOXINE PHOSPHATE [WHO-DD], VITAMIN B6 (PYRIDOXINE PHOSPHATE), 3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, alpha(3)-(dihydrogen phosphate), 3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, alpha(sup 3)-(dihydrogen phosphate), Pyridoxol-d3 5'-Phosphate, Pyridoxol 5'-Phosphate >90%, (5-Hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl)methyl dihydrogen phosphate, {[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methoxy}phosphonic acid, 3,4-PYRIDINEDIMETHANOL, 5-HYDROXY-6-METHYL-, .ALPHA.3-(DIHYDROGEN PHOSPHATE), PXP, Pyridoxine 5'-phosphoric acid, ((5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl)methoxy)phosphonic acid, pyridoxol-5'-phosphate, starbld0048940, Pyridoxine phosphoric acid, Pyridoxol 5-phosphoric acid, Pyridoxyl-5-phosphoric acid, Pyridoxine 5-phosphoric acid, SCHEMBL43880, Pyridoxol 5'-phosphoric acid, PYRIDOXINE-5'-phosphoric acid, DTXCID90118769, WHOMFKWHIQZTHY-UHFFFAOYSA-N, NSC83119, DB02209, FP57732, DB-229386, Pyridoxine 5'-(dihydrogen phosphoric acid), NS00042953, C00627, G91071, Q27093255, (5-Hydroxy-6-methyl-4-methylol-3-pyridyl)methyl dihydrogen phosphate, 5-hydroxy-6-methyl-3,4-Pyridinedimethanol alpha( 3)-(dihydrogen phosphate), 5-Hydroxy-6-methyl-3,4-pyridinedimethanol alpha(3)-(dihydrogen phosphate), 3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, alpha(sup 3)-(dihydrogen phosphate) (9CI), 3,4-PYRIDINEDIMETHANOL, 5-HYDROXY-6-METHYL-, ALPHA3-(DIHYDROGEN PHOSPHATE), 207-179-6 |
|---|---|
| Topological Polar Surface Area | 120.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 16.0 |
| Description | Pyridoxine phosphate, also known as pyridoxine 5-phosphoric acid or pyridoxine 5'-(dihydrogen phosphate), is a member of the class of compounds known as pyridoxine-5'-phosphates. Pyridoxine-5'-phosphates are pyridoxines that carry a phosphate group at the 5-position. Pyridoxine phosphate is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Pyridoxine phosphate can be found primarily in blood. Within the cell, pyridoxine phosphate is primarily located in the cytoplasm (predicted from logP). Pyridoxine phosphate exists in all living species, ranging from bacteria to humans. In humans, pyridoxine phosphate is involved in the vitamin B6 metabolism. Pyridoxine phosphate is also involved in hypophosphatasia, which is a metabolic disorder. Moreover, pyridoxine phosphate is found to be associated with obesity. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 269.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl dihydrogen phosphate |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Xlogp | -1.9 |
| Is Pains | False |
| Molecular Formula | C8H12NO6P |
| Prediction Swissadme | 0.0 |
| Inchi Key | WHOMFKWHIQZTHY-UHFFFAOYSA-N |
| Fcsp3 | 0.375 |
| Logs | -0.713 |
| Rotatable Bond Count | 4.0 |
| Logd | -0.619 |
| Compound Name | Pyridoxine 5'-phosphate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 249.04 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 249.04 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 249.16 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -0.22018579999999954 |
| Inchi | InChI=1S/C8H12NO6P/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h2,10-11H,3-4H2,1H3,(H2,12,13,14) |
| Smiles | CC1=NC=C(C(=C1O)CO)COP(=O)(O)O |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:cmaup_ingredients