Pyridoxamine Phosphate
PubChem CID: 1053
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | pyridoxamine phosphate, PYRIDOXAMINE-5'-PHOSPHATE, 529-96-4, pyridoxamine 5'-phosphate, Pyridoxamine 5-phosphate, Pyridoxamine-P, Pyridoxamine phosphate [JAN], [4-(aminomethyl)-5-hydroxy-6-methylpyridin-3-yl]methyl dihydrogen phosphate, Pyridoxamine, dihydrogen phosphate, AMMONIUM FERRIC CHLORIDE, Pyridoxamine, 3-(dihydrogen phosphate), BRN 0233653, EINECS 208-471-6, 4'-DEOXY-4'-AMINOPYRIDOXAL-5'-PHOSPHATE, Q05R77UO7P, Pyridoxamine 5'-phosphoric acid, DTXSID3046825, CHEBI:18335, pyridoxamine-5-phosphate, PYRIDOXAMINE PHOSPHATE ANHYDROUS, 4-(Aminomethyl)-5-hydroxy-6-methyl-3-pyridinemethanol alpha-(dihydrogen phosphate), Pyridoxamine 5-phosphoric acid, 16774-56-4, DTXCID1026825, 4-22-00-06065 (Beilstein Handbook Reference), 4-Aminomethyl-3-hydroxy-2-methyl-5-((phosphonooxy)methyl)pyridine dihydrate, 3-Pyridinemethanol, 4-(aminomethyl)-5-hydroxy-6-methyl-, alpha-(dihydrogen phosphate), pyridoxamine 5'-(dihydrogen phosphate), PYRIDOXAMINE PHOSPHATE [WHO-DD], PYRIDOXAMINE 5'-PHOSPHATE [MI], NCGC00181045-01, Pyridoxamine, dihydrogen phosphate (7CI), (4-(aminomethyl)-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate, Pyridoxamine 5 inverted exclamation marka-phosphate, Pyridoxamine Phosphate (JAN), {[4-(aminomethyl)-5-hydroxy-6-methylpyridin-3-yl]methoxy}phosphonic acid, 4-AMINOMETHYL-3-HYDROXY-2-METHYL-5-((PHOSPHONOOXY)METHYL)PYRIDINE, UNII-Q05R77UO7P, ((4-(aminomethyl)-5-hydroxy-6-methylpyridin-3-yl)methoxy)phosphonic acid, 1zc9, bmse000131, 529-96-4, anhydride, SCHEMBL43832, Pyridoxamine 5a(2)-phosphate, CHEMBL1235353, HY-B1746, Tox21_112693, MFCD00023504, DB02142, NCGC00181045-02, CAS-529-96-4, DB-052230, CS-0013766, NS00014914, C00647, G77475, Pyridoxamine-5'-phosphate, >=98.0% (HPLC), SBI-0654078.0001, Pyridoxamine-5 inverted exclamation marka-phosphate, Q27093205, 4-Aminomethyl-5-hydroxy-6-methyl-3-pyridylmethyl phosphate, [4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridyl]methyl dihydrogen phosphate, 3-Pyridinemethanol, 4-(aminomethyl)-5-hydroxy-6-methyl-, 3-(dihydrogen phosphate), 208-471-6, PZP |
|---|---|
| Topological Polar Surface Area | 126.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 16.0 |
| Pathway Kegg Map Id | map00750 |
| Description | Vitamin B6 is a water-soluble compound that was discovered in 1930s during nutrition studies on rats. The vitamin was named pyridoxine to indicate its structural homology to pyridine. Later it was shown that vitamin B6 could exist in two other, slightly different, chemical forms, termed pyridoxal and pyridoxamine. All three forms of vitamin B6 are precursors of an activated compound known as pyridoxal 5-phosphate (PLP), which plays a vital role as the cofactor of a large number of essential enzymes in the human body. Vitamin B6 is a water-soluble vitamin. The three major forms of vitamin B6 are pyridoxine (also known as pyridoxol), pyridoxal, and pyridoxamine, which are all converted in the liver to pyridoxal 5-phosphate (PLP) a cofactor in many reactions of amino acid metabolism. PLP also is necessary for the enzymatic reaction governing the release of glucose from glycogen. [HMDB]. Pyridoxamine 5'-phosphate is found in many foods, some of which are cardamom, pepper (spice), potato, and white cabbage. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 271.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P08659, O94925 |
| Iupac Name | [4-(aminomethyl)-5-hydroxy-6-methylpyridin-3-yl]methyl dihydrogen phosphate |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Pyridines and derivatives |
| Xlogp | -4.4 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Subclass | Pyridoxamines |
| Molecular Formula | C8H13N2O5P |
| Prediction Swissadme | 0.0 |
| Inchi Key | ZMJGSOSNSPKHNH-UHFFFAOYSA-N |
| Fcsp3 | 0.375 |
| Logs | 0.371 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Logd | -0.85 |
| Synonyms | 4'-DEOXY-4'-aminopyridoxal-5'-ATE, 4'-DEOXY-4'-aminopyridoxal-5'-ic acid, Pyridoxamine 5-ate, Pyridoxamine 5-ic acid, Pyridoxamine 5'-(dihydrogen ate), Pyridoxamine 5'-(dihydrogen ic acid), Pyridoxamine 5'-ate, Pyridoxamine 5'-ic acid, Pyridoxamine ate, Pyridoxamine ic acid |
| Substituent Name | Pyridoxamine, Methylpyridine, Hydroxypyridine, Aralkylamine, Monoalkyl phosphate, Alkyl phosphate, Phosphoric acid ester, Organic phosphoric acid derivative, Organic phosphate, Heteroaromatic compound, Azacycle, Hydrocarbon derivative, Primary amine, Organooxygen compound, Organonitrogen compound, Primary aliphatic amine, Amine, Aromatic heteromonocyclic compound |
| Compound Name | Pyridoxamine Phosphate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 248.056 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 248.056 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 248.17 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 1.5562150000000003 |
| Inchi | InChI=1S/C8H13N2O5P/c1-5-8(11)7(2-9)6(3-10-5)4-15-16(12,13)14/h3,11H,2,4,9H2,1H3,(H2,12,13,14) |
| Smiles | CC1=NC=C(C(=C1O)CN)COP(=O)(O)O |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all