(1S,4aS,4bR,7S,10aS)-7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-2,4,4b,5,6,9,10,10a-octahydrophenanthren-3-one
PubChem CID: 10494596
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | True |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCC3CCCCC3C2C1 |
| Np Classifier Class | Pimarane and Isopimarane diterpenoids |
| Deep Smiles | C=C[C@]C)CC[C@@H]C=C6)CC[C@H][C@@]6C)CC=O)C[C@]6C)CO |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CCC2CCC3CCCCC3C2C1 |
| Classyfire Subclass | Diterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 534.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (1S,4aS,4bR,7S,10aS)-7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-2,4,4b,5,6,9,10,10a-octahydrophenanthren-3-one |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.9 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C20H30O2 |
| Scaffold Graph Node Bond Level | O=C1CCC2CCC3=CCCCC3C2C1 |
| Inchi Key | HKFZBGDCJPXQHN-WAPOTWQKSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | trifolione a |
| Esol Class | Moderately soluble |
| Functional Groups | C=CC, CC(C)=CC, CC(C)=O, CO |
| Compound Name | (1S,4aS,4bR,7S,10aS)-7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-2,4,4b,5,6,9,10,10a-octahydrophenanthren-3-one |
| Exact Mass | 302.225 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 302.225 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 302.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C20H30O2/c1-5-18(2)9-8-16-14(10-18)6-7-17-19(3,13-21)11-15(22)12-20(16,17)4/h5,10,16-17,21H,1,6-9,11-13H2,2-4H3/t16-,17-,18-,19-,20+/m1/s1 |
| Smiles | C[C@]1(CC[C@@H]2C(=C1)CC[C@H]3[C@]2(CC(=O)C[C@]3(C)CO)C)C=C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Cardamine Hirsuta (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Cassia Hirsuta (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Dumortiera Hirsuta (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Dysosma Furfuracea (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Grewia Hirsuta (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Herniaria Hirsuta (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Indigofera Hirsuta (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Knema Attenuata (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Knema Cinerea (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Knema Erratica (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Knema Globularia (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Mucuna Hirsuta (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Neanotis Hirsuta (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Primula Hirsuta (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Sagittaria Trifolia (Plant) Rel Props:Reference:ISBN:9780387706375; ISBN:9788185042145 - 16. Outgoing r'ship
FOUND_INto/from Senna Hirsuta (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Sideritis Hirsuta (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Tylophora Hirsuta (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Uncaria Hirsuta (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Vicia Hirsuta (Plant) Rel Props:Reference: