1,9,13-Trimeth yl-8-tridecyl-1,5,9,13-tetraazacycloheptadecan-6-one
PubChem CID: 10412907
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | SCHEMBL6311048, 1,9,13-trimeth yl-8-tridecyl-1 ,5,9,13-tetraazacycloheptadecan-6-one |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 38.8 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCCCCCCCCCCCCCC1 |
| Np Classifier Class | Polyamines |
| Deep Smiles | CCCCCCCCCCCCCCCC=O)NCCCNC)CCCCNCCCN%17C)))))C |
| Heavy Atom Count | 34.0 |
| Classyfire Class | Macrolactams |
| Scaffold Graph Node Level | OC1CCNCCCNCCCCNCCCN1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 473.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1,9,13-trimethyl-8-tridecyl-1,5,9,13-tetrazacycloheptadecan-6-one |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 7.5 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C29H60N4O |
| Scaffold Graph Node Bond Level | O=C1CCNCCCNCCCCNCCCN1 |
| Inchi Key | BQJBXNLTMGZMKS-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 12.0 |
| Synonyms | budmunchiamine c |
| Esol Class | Poorly soluble |
| Functional Groups | CN(C)C, CNC(C)=O |
| Compound Name | 1,9,13-Trimeth yl-8-tridecyl-1,5,9,13-tetraazacycloheptadecan-6-one |
| Exact Mass | 480.477 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 480.477 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 480.8 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C29H60N4O/c1-5-6-7-8-9-10-11-12-13-14-15-20-28-27-29(34)30-21-18-24-31(2)22-16-17-23-32(3)25-19-26-33(28)4/h28H,5-27H2,1-4H3,(H,30,34) |
| Smiles | CCCCCCCCCCCCCC1CC(=O)NCCCN(CCCCN(CCCN1C)C)C |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Ornithine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Albizia Amara (Plant) Rel Props:Reference:ISBN:9788185042145