Norcamphor
PubChem CID: 10345
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | NORCAMPHOR, 497-38-1, 2-Norbornanone, Bicyclo[2.2.1]heptan-2-one, Norcampher, 2-Oxonorbornane, Norbornan-2-one, 2,5-Methanocyclohexanone, Bicyclo(2.2.1)heptan-2-one, EINECS 207-846-1, MFCD00074823, NSC 66537, AI3-51353, Bicyclo(2.2.1)-2-heptanone, Bicyclo[2.2.1]heptane-2-one, DTXSID50883406, rac-Norcamphor, Bicyclo[2.2.1]-2-heptanone, Bicyclo(2.2.1)heptane-2-one, 8,9,10-Trinorbornan-2-one, Norbornanone, 2Norbornanone, 2Oxonorbornane, 2-Norcamphor, (+)-2-norbornanone, (-)-2-norbornanone, 2,5Methanocyclohexanone, 8,9,10Trinorbornan2one, Bicyclo(2.2.1)heptan2one, NCIOpen2_001420, SCHEMBL83478, (1S,4R)-norbornan-2-one, CHEMBL361682, DTXCID90987937, CHEBI:232344, NSC66537, NSC92359, NSC-66537, NSC-92359, AKOS000121061, AKOS022146289, CCG-358829, FN10619, PB42918, LS-13291, SY049592, Norcamphor, Bicyclo[2.2.1]-2-heptanone, CS-0072123, N0511, NS00043003, EN300-15383, Q7050470, F0001-1297 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC2CCC1C2 |
| Deep Smiles | O=CCCCC5CC5 |
| Heavy Atom Count | 8.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CC2CCC1C2 |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 128.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | bicyclo[2.2.1]heptan-2-one |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 1.0 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C7H10O |
| Scaffold Graph Node Bond Level | O=C1CC2CCC1C2 |
| Inchi Key | KPMKEVXVVHNIEY-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | bicyclo [2.2.1] heptan-2-one |
| Esol Class | Very soluble |
| Functional Groups | CC(C)=O |
| Compound Name | Norcamphor |
| Exact Mass | 110.073 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 110.073 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 110.15 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C7H10O/c8-7-4-5-1-2-6(7)3-5/h5-6H,1-4H2 |
| Smiles | C1CC2CC1CC2=O |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Rosmarinus Officinalis (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2018.1491331 - 2. Outgoing r'ship
FOUND_INto/from Salvia Officinalis (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2018.1491331