3'-Hydroxy-4'-methoxyglabridin
PubChem CID: 10338211
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 3'-Hydroxy-4'-methoxyglabridin, 3'-Hydroxy-4'-O-methylglabridin, SCHEMBL12866271, CHEBI:175557, PPBISUGOQDBBEL-UHFFFAOYSA-N, 3-(8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-]chromen-3-yl)-6-methoxybenzene-1,2-diol, 3-{8,8-dimethyl-2H,3H,4H,8H-pyrano[2,3-f]chromen-3-yl}-6-methoxybenzene-1,2-diol, (R)-3-(8,8-Dimethyl-2,3,4,8-tetrahydropyrano[2,3-f]chromen-3-yl)-6-methoxybenzene-1,2-diol, 1,2-Benzenediol, 3-[(3R)-3,4-dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b']dipyran-3-yl]-6-methoxy-, 1,2-Benzenediol, 3-[3,4-dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b']dipyran-3-yl]-6-methoxy-, (R)- |
|---|---|
| Topological Polar Surface Area | 68.2 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 26.0 |
| Description | Isolated from Glycyrrhiza glabra (licorice). 3'-Hydroxy-4'-methoxyglabridin is found in tea and herbs and spices. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 532.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-(8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl)-6-methoxybenzene-1,2-diol |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Xlogp | 3.9 |
| Is Pains | True |
| Molecular Formula | C21H22O5 |
| Prediction Swissadme | 1.0 |
| Inchi Key | PPBISUGOQDBBEL-UHFFFAOYSA-N |
| Fcsp3 | 0.3333333333333333 |
| Logs | -4.229 |
| Rotatable Bond Count | 2.0 |
| Logd | 3.931 |
| Synonyms | 3'-Hydroxy-4'-methoxyglabridin, 3'-Methoxyglabridin |
| Compound Name | 3'-Hydroxy-4'-methoxyglabridin |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 354.147 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 354.147 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 354.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -4.678630861538462 |
| Inchi | InChI=1S/C21H22O5/c1-21(2)9-8-15-16(26-21)6-4-12-10-13(11-25-20(12)15)14-5-7-17(24-3)19(23)18(14)22/h4-9,13,22-23H,10-11H2,1-3H3 |
| Smiles | CC1(C=CC2=C(O1)C=CC3=C2OCC(C3)C4=C(C(=C(C=C4)OC)O)O)C |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Glycyrrhiza Glabra (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Glycyrrhiza Inflata (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Glycyrrhiza Uralensis (Plant) Rel Props:Source_db:cmaup_ingredients