Photocitral A
PubChem CID: 102684
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Photocitral A, 1753-98-6, 2-methyl-5-prop-1-en-2-ylcyclopentane-1-carbaldehyde, 2-Methyl-5-(1-methylvinyl)cyclopentanecarbaldehyde, 2-METHYL-5-(PROP-1-EN-2-YL)CYCLOPENTANE-1-CARBALDEHYDE, epi-Photocitral A, epiphotocitral A, EINECS 217-141-0, SCHEMBL20446694, DTXSID50866471, CHEBI:171976, NS00046298, 2-Isopropenyl-5-methylcyclopentanecarbaldehyde, 2-isopropenyl-5-methyl-1-cyclopentanecarboxaldehyde |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCC1 |
| Np Classifier Class | Menthane monoterpenoids |
| Deep Smiles | O=CCCC)CCC5C=C)C |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Prenol lipids |
| Description | Flavouring ingredient |
| Scaffold Graph Node Level | C1CCCC1 |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 172.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-methyl-5-prop-1-en-2-ylcyclopentane-1-carbaldehyde |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.9 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Monoterpenoids |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H16O |
| Scaffold Graph Node Bond Level | C1CCCC1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JCDLXWAYWSJVTP-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.7 |
| Logs | -2.286 |
| Rotatable Bond Count | 2.0 |
| State | Solid |
| Logd | 2.064 |
| Synonyms | 2-Isopropenyl-5-methylcyclopentanecarboxaldehyde, cis,cis-form, FEMA 3645, Epiphotocitral A, 2-Isopropenyl-5-methylcyclopentanecarbaldehyde, Photocitral A, hexahydro-5a-Methyl-3H-1,6:3,8a-dimethano-1H-cyclopent[c]oxepin, 8ci, epiphotocitral a, photo citral a, photocitral a, photocitral-a |
| Esol Class | Soluble |
| Functional Groups | C=C(C)C, CC=O |
| Compound Name | Photocitral A |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 152.12 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 152.12 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 152.23 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -2.4599694 |
| Inchi | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(9)6-11/h6,8-10H,1,4-5H2,2-3H3 |
| Smiles | CC1CCC(C1C=O)C(=C)C |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Monocyclic monoterpenoids |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Aloysia Citriodora (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2008.9700028 - 2. Outgoing r'ship
FOUND_INto/from Amomum Zingiber (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Cnidium Officinale (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Cupressus Macrocarpa (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2018.1496857 - 5. Outgoing r'ship
FOUND_INto/from Cupressus Sempervirens (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2018.1496857 - 6. Outgoing r'ship
FOUND_INto/from Cynoglossum Officinale (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Euphrasia Officinale (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Guaiacum Officinale (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Hyssopus Officinale (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Jasminum Officinale (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Levisticum Officinale (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Lithospermum Officinale (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Nasturtium Officinale (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Nepeta Cataria (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1997.9700770 - 15. Outgoing r'ship
FOUND_INto/from Nerium Oleander (Plant) Rel Props:Reference:ISBN:9770972795006 - 16. Outgoing r'ship
FOUND_INto/from Peucedanum Officinale (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Rheum Officinale (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Schoenocaulon Officinale (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Sisymbrium Officinale (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Symphytum Officinale (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Taraxacum Officinale (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Zingiber Aromaticum (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Zingiber Capitatum (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Zingiber Cassumunar (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Zingiber Cernuum (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Zingiber Chrysanthum (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Zingiber Montanum (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 29. Outgoing r'ship
FOUND_INto/from Zingiber Purpureum (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Zingiber Roseum (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Zingiber Rubens (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Zingiber Spectabile (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Zingiber Zerumbet (Plant) Rel Props:Reference: