(3S,4R,5S)-3-[9-[(5R)-5-[(1R,4R)-1,4-dihydroxy-4-[(2R,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]nonyl]-4-hydroxy-5-methyloxolan-2-one
PubChem CID: 102574800
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 126.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCC1CCCCCCCCCC1CCC(CCCCC2CCCC2)C1 |
| Np Classifier Class | Acetogenins |
| Deep Smiles | CCCCCCCCCC[C@@H][C@H]CC[C@@H]O5)[C@@H]CC[C@H][C@H]CCCO5)CCCCCCCCC[C@@H]C=O)O[C@H][C@@H]5O))C))))))))))))))))))O))))O))))))O |
| Heavy Atom Count | 45.0 |
| Classyfire Class | Fatty acyls |
| Scaffold Graph Node Level | OC1OCCC1CCCCCCCCCC1CCC(CCCCC2CCCO2)O1 |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 780.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 9.0 |
| Iupac Name | (3S,4R,5S)-3-[9-[(5R)-5-[(1R,4R)-1,4-dihydroxy-4-[(2R,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]nonyl]-4-hydroxy-5-methyloxolan-2-one |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 8.8 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C37H68O8 |
| Scaffold Graph Node Bond Level | O=C1OCCC1CCCCCCCCCC1CCC(CCCCC2CCCO2)O1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | BIXWLUMDIFSPDE-UEXGOLEZSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.972972972972973 |
| Logs | -5.834 |
| Rotatable Bond Count | 25.0 |
| Logd | 4.572 |
| Synonyms | otivarin |
| Esol Class | Poorly soluble |
| Functional Groups | CO, COC, COC(C)=O |
| Compound Name | (3S,4R,5S)-3-[9-[(5R)-5-[(1R,4R)-1,4-dihydroxy-4-[(2R,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]nonyl]-4-hydroxy-5-methyloxolan-2-one |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 640.491 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 640.491 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 640.9 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Esol | -7.733046600000005 |
| Inchi | InChI=1S/C37H68O8/c1-3-4-5-6-7-11-14-17-20-30(38)34-25-26-35(45-34)32(40)23-22-31(39)33-24-21-28(44-33)18-15-12-9-8-10-13-16-19-29-36(41)27(2)43-37(29)42/h27-36,38-41H,3-26H2,1-2H3/t27-,28?,29-,30-,31+,32+,33+,34+,35+,36-/m0/s1 |
| Smiles | CCCCCCCCCC[C@@H]([C@H]1CC[C@@H](O1)[C@@H](CC[C@H]([C@H]2CCC(O2)CCCCCCCCC[C@H]3[C@H]([C@@H](OC3=O)C)O)O)O)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Linear polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Annona Cherimola (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all; Reference:ISBN:9788185042145