Lumazine
PubChem CID: 10250
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Lumazine, 487-21-8, 2,4-Pteridinediol, 2,4-DIHYDROXYPTERIDINE, 2,4(1H,3H)-Pteridinedione, Lumazin, pteridine-2,4(1H,3H)-dione, pteridine-2,4-diol, Pteridine-2,4-dione, 1H-pteridine-2,4-dione, 2,4(3H,8H)-Pteridinedione, Lumazine (VAN), NSC 41801, NSC 225113, Pteridine-2,4-diol monohydrate, 2,4-(1H,3H)-Pteridinedione, EINECS 207-652-7, 1H,3H-pteridine-2,4-dione, 260MF9U4WC, CHEBI:16489, LUMAZINE [MI], MFCD00066250, NSC-41801, 525-77-9, NSC-225113, DTXSID0060068, NSC41801, 2,3H)-Pteridinedione, 2,8H)-Pteridinedione, pteridinedione, UNII-260MF9U4WC, LUZ, pteridin-2,4-dione, Lumazine, 97%, 1,2,3,4-tetrahydropteridine-2,4-dione, Lumazine (VAN) (8CI), pteridine, 2,4-dihydroxy-, Oprea1_489423, SCHEMBL321932, 4-hydroxy-3H-pteridin-2-one, PYRAZINO[2,3-d]PYRIMIDINE-2,4(1H,3H)-DIONE, CHEMBL1234104, DTXCID9040639, CHEBI:73186, UYEUUXMDVNYCAM-UHFFFAOYSA-, Pteridinedione, 2,4(1h,3h)-, BBL037035, NSC225113, STL373614, STL556695, AKOS000121322, AKOS002337448, AKOS024015255, FP52412, HY-W037619, 2,3,4,8-tetrahydropteridine-2,4-dione, BP-11303, DA-17466, DS-13683, SY009609, CS-0094050, L0086, NS00031820, EN300-21263, C03212, AB-323/25048461, Lumazine, 2,4-Pteridinediol, 2,4-Dihydroxypteridine, Pyrazino [2,3-d]Pyrimidine- 2,4(1H,3H)-Dione, Lumazine, 2,4-dihydroxypteridine, 2,4-pteridinediol, Q17189420, Z104494912, InChI=1/C6H4N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h1-2H,(H2,8,9,10,11,12) |
|---|---|
| Topological Polar Surface Area | 84.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | UYEUUXMDVNYCAM-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| Synonyms | 1H,3H-pteridine-2,4-dione, 2, 4(3H,8H)-Pteridinedione, 2,4-Dihydroxypteridine, 2,4-Pteridinediol, 2,4(1H,3H)-Pteridinedione, 2,4(3H,8H)-Pteridinedione, Lumazin, Lumazine (van), Lumazine (VAN) (8CI), LUZ, pteridine-2,4-diol, Pteridine-2,4-diol monohydrate, Pteridine-2,4-dione, Pteridinedione, 2,4(1h,3h)- |
| Heavy Atom Count | 12.0 |
| Compound Name | Lumazine |
| Description | Lumazine, also known as pteridine-2,4-dione or 2,4(3h,8h)-pteridinedione, belongs to pteridines and derivatives class of compounds. Those are polycyclic aromatic compounds containing a pteridine moiety, which consists of a pyrimidine fused to a pyrazine ring to form pyrimido(4,5-b)pyrazine. Lumazine is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Lumazine can be found in soy bean, which makes lumazine a potential biomarker for the consumption of this food product. |
| Exact Mass | 164.033 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 164.033 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 230.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 164.12 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1H-pteridine-2,4-dione |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C6H4N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h1-2H,(H2,8,9,10,11,12) |
| Smiles | C1=CN=C2C(=N1)C(=O)NC(=O)N2 |
| Xlogp | -1.0 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C6H4N4O2 |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all