Dipotassium
PubChem CID: 102439234
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 107.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCCCC1 |
| Deep Smiles | [O-]C=O)coccc=O)c6)))C=O)[O-].[K+].[K+] |
| Heavy Atom Count | 15.0 |
| Classyfire Class | Pyrans |
| Scaffold Graph Node Level | OC1CCOCC1 |
| Classyfire Subclass | Pyranones and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 305.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | dipotassium, 4-oxopyran-2,6-dicarboxylate |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Gsk 4 400 Rule | True |
| Molecular Formula | C7H2K2O6 |
| Scaffold Graph Node Bond Level | O=c1ccocc1 |
| Inchi Key | NUWJHVONJMHIKQ-UHFFFAOYSA-L |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | potassium chelidonate |
| Esol Class | Very soluble |
| Functional Groups | [K+], c=O, cC(=O)[O-], coc |
| Compound Name | Dipotassium, 4-oxopyran-2,6-dicarboxylate |
| Exact Mass | 259.913 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 259.913 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 260.279 |
| Gi Absorption | False |
| Covalent Unit Count | 3.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C7H4O6.2K/c8-3-1-4(6(9)10)13-5(2-3)7(11)12, , /h1-2H,(H,9,10)(H,11,12), , /q, 2*+1/p-2 |
| Smiles | C1=C(OC(=CC1=O)C(=O)[O-])C(=O)[O-].[K+].[K+] |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
- 1. Outgoing r'ship
FOUND_INto/from Senna Occidentalis (Plant) Rel Props:Reference:ISBN:9788172363178