[(1aS,2aR,5R,5aS,6S,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 4-hydroxybenzoate
PubChem CID: 10237282
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | CHEMBL4640705 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 79.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CC1CC2CC2CC2CCCC21)C1CCCCC1 |
| Np Classifier Class | Daucane sesquiterpenoids |
| Deep Smiles | Occcccc6))C=O)O[C@H]C[C@@]C)O[C@H]3C[C@@][C@@H]8[C@@]O)CC5))CC)C))))C |
| Heavy Atom Count | 27.0 |
| Classyfire Class | Benzene and substituted derivatives |
| Scaffold Graph Node Level | OC(OC1CC2OC2CC2CCCC21)C1CCCCC1 |
| Classyfire Subclass | Benzoic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 598.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | [(1aS,2aR,5R,5aS,6S,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 4-hydroxybenzoate |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 3.8 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C22H30O5 |
| Scaffold Graph Node Bond Level | O=C(OC1CC2OC2CC2CCCC21)c1ccccc1 |
| Inchi Key | NZRACXOBLXBSFK-IVDWBNGSSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | jaeskeanin |
| Esol Class | Moderately soluble |
| Functional Groups | CO, C[C@@H]1O[C@@]1(C)C, cC(=O)OC, cO |
| Compound Name | [(1aS,2aR,5R,5aS,6S,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 4-hydroxybenzoate |
| Exact Mass | 374.209 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 374.209 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 374.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C22H30O5/c1-13(2)22(25)10-9-20(3)12-17-21(4,27-17)11-16(18(20)22)26-19(24)14-5-7-15(23)8-6-14/h5-8,13,16-18,23,25H,9-12H2,1-4H3/t16-,17-,18+,20+,21+,22+/m0/s1 |
| Smiles | CC(C)[C@@]1(CC[C@]2([C@H]1[C@H](C[C@@]3([C@H](C2)O3)C)OC(=O)C4=CC=C(C=C4)O)C)O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Ferula Alliacea (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Ferula Ammoniacum (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Ferula Arrigonii (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Ferula Asafoetida (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Ferula Borealis (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Ferula Foetida (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Ferula Fukanensis (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Ferula Galbaniflua (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Ferula Gummosa (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Ferula Jaeschkeana (Plant) Rel Props:Reference:ISBN:9770972795006; ISBN:9788172362300; ISBN:9788185042145 - 11. Outgoing r'ship
FOUND_INto/from Ferula Kuhistanica (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Ferula Moschata (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Ferula Narthex (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Ferula Oopoda (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Ferula Ovina (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Ferula Persica (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Ferula Polyantha (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Ferula Transiliensis (Plant) Rel Props:Reference: