[(1S,2R,5S,6S,10S,12S,13R,14R,15R,17S)-13-acetyloxy-6-(furan-3-yl)-17-(2-methoxy-2-oxoethyl)-1,5,16,16-tetramethyl-8,18-dioxo-7,11-dioxapentacyclo[12.3.1.02,12.05,10.010,12]octadecan-15-yl] 2-methylpropanoate
PubChem CID: 102274582
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 148.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC(C2CCCC2)C2CCC3C4CCCC(CC35CC25C1)C4C |
| Np Classifier Class | Limonoids |
| Deep Smiles | COC=O)C[C@H]CC)C)[C@H]OC=O)CC)C))))[C@H]C=O)[C@]6C)[C@H]CC[C@@][C@][C@]6[C@@H]%10OC=O)C))))O3))CC=O)O[C@H]6cccoc5))))))))))C |
| Heavy Atom Count | 44.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CC23OC24CC2CCCC(C2O)C4CCC3C(C2CCOC2)O1 |
| Classyfire Subclass | Triterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1290.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | [(1S,2R,5S,6S,10S,12S,13R,14R,15R,17S)-13-acetyloxy-6-(furan-3-yl)-17-(2-methoxy-2-oxoethyl)-1,5,16,16-tetramethyl-8,18-dioxo-7,11-dioxapentacyclo[12.3.1.02,12.05,10.010,12]octadecan-15-yl] 2-methylpropanoate |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.1 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C33H42O11 |
| Scaffold Graph Node Bond Level | O=C1CC23OC24CC2CCCC(C2=O)C4CCC3C(c2ccoc2)O1 |
| Inchi Key | QLZCMLMAZOYMSC-ZXYZIBDASA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 9.0 |
| Synonyms | xyloccensin g |
| Esol Class | Moderately soluble |
| Functional Groups | CC(=O)OC, CC(C)=O, COC(C)=O, C[C@@]1(C)O[C@@]1(C)C, coc |
| Compound Name | [(1S,2R,5S,6S,10S,12S,13R,14R,15R,17S)-13-acetyloxy-6-(furan-3-yl)-17-(2-methoxy-2-oxoethyl)-1,5,16,16-tetramethyl-8,18-dioxo-7,11-dioxapentacyclo[12.3.1.02,12.05,10.010,12]octadecan-15-yl] 2-methylpropanoate |
| Exact Mass | 614.273 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 614.273 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 614.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C33H42O11/c1-16(2)28(38)43-26-23-24(37)31(7,20(29(26,4)5)13-21(35)39-8)19-9-11-30(6)25(18-10-12-40-15-18)42-22(36)14-32(30)33(19,44-32)27(23)41-17(3)34/h10,12,15-16,19-20,23,25-27H,9,11,13-14H2,1-8H3/t19-,20+,23-,25+,26-,27-,30+,31-,32+,33+/m1/s1 |
| Smiles | CC(C)C(=O)O[C@@H]1[C@@H]2[C@H]([C@@]34[C@H](CC[C@@]5([C@@]3(O4)CC(=O)O[C@H]5C6=COC=C6)C)[C@@](C2=O)([C@H](C1(C)C)CC(=O)OC)C)OC(=O)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Xylocarpus Moluccensis (Plant) Rel Props:Reference:ISBN:9788185042114