(1R,3R,7S,8R)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine
PubChem CID: 101967077
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 24.5 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CC3CC1C2C3 |
| Np Classifier Class | Pyrrolizidine alkaloids |
| Deep Smiles | CN[C@H][C@H]CN[C@@H]5[C@H]O6)CC5 |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Loline alkaloids and derivatives |
| Scaffold Graph Node Level | C1CN2CC3CC2C1O3 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 185.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (1R,3R,7S,8R)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | -0.4 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C8H14N2O |
| Scaffold Graph Node Bond Level | C1CN2CC3CC2C1O3 |
| Inchi Key | OPMNROCQHKJDAQ-OOJXKGFFSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | loline |
| Esol Class | Very soluble |
| Functional Groups | CN(C)C, CNC, COC |
| Compound Name | (1R,3R,7S,8R)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine |
| Exact Mass | 154.111 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 154.111 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 154.21 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C8H14N2O/c1-9-7-6-4-10-3-2-5(11-6)8(7)10/h5-9H,2-4H2,1H3/t5-,6-,7+,8-/m1/s1 |
| Smiles | CN[C@H]1[C@H]2CN3[C@@H]1[C@H](O2)CC3 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Ornithine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Lolium Temulentum (Plant) Rel Props:Reference:ISBN:9788172362461