Lucidin
PubChem CID: 10163
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Lucidin, 478-08-0, Henine, 1,3-dihydroxy-2-(hydroxymethyl)anthracene-9,10-dione, Lucidin (quinone), 1,3-Dihydroxy-2-(hydroxymethyl)anthraquinone, NSC 30546, CCRIS 1642, HSDB 7146, BRN 1888954, UNII-60Q5564O9D, 1,3-Dihydroxy-2-hydroxymethylanthraquinoline, LUCIDIN [HSDB], NSC-30546, Anthraquinone, 1,3-dihydroxy-2-(hydroxymethyl)-, 60Q5564O9D, Lucidin (NSC 30546), 9,10-Anthracenedione, 1,3-dihydroxy-2-(hydroxymethyl)-, DTXSID10197278, 4-08-00-03576 (Beilstein Handbook Reference), ANTHRAQUINONE, 1,3-DIHYDROXY-2-HYDROXYMETHYL-, DIHYDROXY-2-(HYDROXYMETHYL)ANTHRAQUINONE, 1,3-, Madder root, Lucidin (Standard), MFCD01664482, SCHEMBL705681, CHEBI:6554, DTXCID20119769, GLXC-04460, BCP31463, NSC30546, FD5009, HY-15733R, AKOS027328039, CS-1555, FL74193, 9, 1,3-dihydroxy-2-(hydroxymethyl)-, 1,3Dihydroxy2(hydroxymethyl)anthraquinone, BS-16831, HY-15733, WLN: L C666 BV IVJ DQ E1Q FQ, DB-081419, Anthraquinone, 1,3dihydroxy2(hydroxymethyl), NS00094623, Anthraquinone,3-dihydroxy-2-(hydroxymethyl)-, 1,3-Dihydroxy-2-hydroxymethyl-9,10-anthraquinone, 9,10Anthracenedione, 1,3dihydroxy2(hydroxymethyl), Q27107238, 9,10Anthracenedione, 1,3dihydroxy2(hydroxymethyl) (9CI), 9,10-Anthracenedione, 1,3-dihydroxy-2-(hydroxymethyl)-(9CI), 1,3-dihydroxy-2-(hydroxymethyl)-9,10-dihydroanthracene-9,10-dione, NSC 30546, Henine, 1,3-Dihydroxy-2-(hydroxymethyl)anthraquinone |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 94.8 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1C2CCCCC2C(C)C2CCCCC12 |
| Np Classifier Class | Anthraquinones and anthrones |
| Deep Smiles | OCccO)cccc6O))C=O)ccC6=O))cccc6 |
| Heavy Atom Count | 20.0 |
| Classyfire Class | Anthracenes |
| Scaffold Graph Node Level | OC1C2CCCCC2C(O)C2CCCCC12 |
| Classyfire Subclass | Anthraquinones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 420.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1,3-dihydroxy-2-(hydroxymethyl)anthracene-9,10-dione |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 2.4 |
| Is Pains | True |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H10O5 |
| Scaffold Graph Node Bond Level | O=C1c2ccccc2C(=O)c2ccccc21 |
| Prediction Swissadme | 0.0 |
| Inchi Key | AMIDUPFSOUCLQB-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.0666666666666666 |
| Logs | -3.669 |
| Rotatable Bond Count | 1.0 |
| Logd | 1.945 |
| Synonyms | lucidin |
| Esol Class | Soluble |
| Functional Groups | CO, cC(c)=O, cO |
| Compound Name | Lucidin |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 270.053 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 270.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 270.24 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.040088 |
| Inchi | InChI=1S/C15H10O5/c16-6-10-11(17)5-9-12(15(10)20)14(19)8-4-2-1-3-7(8)13(9)18/h1-5,16-17,20H,6H2 |
| Smiles | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)CO)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Polycyclic aromatic polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Alangium Platanifolium (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Asperula Odora (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Asperula Odorata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Croton Penduliflorus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Gynochthodes Umbellata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Hymenodictyon Excelsum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Hymenodictyon Orixense (Plant) Rel Props:Reference:ISBN:9788172361792; ISBN:9788185042084 - 8. Outgoing r'ship
FOUND_INto/from Knoxia Valerianoides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Litsea Konishii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Lychnophora Columnaris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Medicago Sativa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Morinda Citrifolia (Plant) Rel Props:Reference:ISBN:9780896038776; ISBN:9788172361792 - 13. Outgoing r'ship
FOUND_INto/from Morinda Umbellata (Plant) Rel Props:Source_db:npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Populus Tomentosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Rubia Akane (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Rubia Cordifolia (Plant) Rel Props:Reference:ISBN:9788171360536 - 17. Outgoing r'ship
FOUND_INto/from Rubia Tinctorum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Rubia Wallichiana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Vepris Louisii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all