1,2,9,10-Tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline
PubChem CID: 10145
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1,2,9,10-Tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline, 5630-11-5, 2,3,5,6-Tetramethoxyaporphine, MLS000111916, SMR000107835, NSC 34396, Glaucine, dl, EINECS 227-068-6, ChemDiv1_020764, O,O-Dimethylisoboldine, S-(+)-Glaucine, NSC 34396, Oprea1_671613, Oprea1_787880, cid_10145, CHEMBL36536, SCHEMBL3040938, BDBM35523, HMS645P18, DTXSID20859390, 4H-Dibenzo[de,g]quinoline, 5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-, (S)-, HMS2270L09, BBL007624, HY-N10824, MFCD00067283, STK375005, AKOS000264934, AKOS021982512, AKOS040764369, CCG-105531, (1)-5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo(de,g)quinoline, 5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo(de,g)quinoline, VS-01695, CS-0636997, NS00017951, 1,2,9,10-Tetramethoxy-6a-.alpha.-aporphine, 6a.alpha.-Aporphine, 1,2,9,10-tetramethoxy-, AE-508/21133002, SR-01000421456, SR-01000421456-1, 1,2,9,10-Tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-, (S)- #, 4,5,15,16-tetramethoxy-10-methyl-10-azatetracyclo[7.7.1.0(2),?.0(1)(3),(1)?]heptadeca-1(16),2,4,6,13(17),14-hexaene |
|---|---|
| Topological Polar Surface Area | 40.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 26.0 |
| Description | Glaucine is a member of the class of compounds known as aporphines. Aporphines are quinoline alkaloids containing the dibenzo[de,g]quinoline ring system or a dehydrogenated derivative thereof. Glaucine is practically insoluble (in water) and a very strong basic compound (based on its pKa). Glaucine can be found in barley and custard apple, which makes glaucine a potential biomarker for the consumption of these food products. Glaucine has bronchodilator and antiinflammatory effects, acting as a PDE4 inhibitor and calcium channel blocker, and is used medically as an antitussive in some countries. Glaucine may produce side effects such as sedation, fatigue, and a hallucinogenic effect characterised by colourful visual images, and has been detected as a novel psychoactive drug . |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 489.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q99714, B2RXH2, P25779, P10636, P00352, Q962Y6, O97447, P00811, P9WHJ3, Q96LD8, Q9BQF6, Q9GZR1, Q96QE3, P9WMR3, Q9UNA4, P42574, O75496, Q9NUW8, P43351, O94782, O95551, Q9NR56, O95398, P0DTD1, n.a. |
| Iupac Name | 1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Aporphines |
| Target Id | NPT149, NPT48, NPT51, NPT94, NPT1255, NPT1256, NPT1257, NPT979, NPT1274, NPT4907 |
| Xlogp | 3.4 |
| Superclass | Alkaloids and derivatives |
| Is Pains | False |
| Molecular Formula | C21H25NO4 |
| Prediction Swissadme | 1.0 |
| Inchi Key | RUZIUYOSRDWYQF-UHFFFAOYSA-N |
| Fcsp3 | 0.4285714285714285 |
| Logs | -2.75 |
| Rotatable Bond Count | 4.0 |
| Logd | 3.013 |
| Synonyms | (+)-glaucine, 1,2,9,10-Tetramethoxy-6a-alpha-aporphine, 6a-alpha-Aporphine, 1,2,9,10-tetramethoxy-, 6a&alpha, -Aporphine, 1,2,9,10-tetramethoxy-, 6aalpha-Aporphine, 1,2,9,10-tetramethoxy-, 6aalpha-Aporphine, 1,2,9,10-tetramethoxy- (8CI), Boldine dimethyl ether, Bromcholitin, D-glaucine, Glaucine fumarate, Glaucine, (s)-isomer, Glaucine,(d), Glauvent, O,O-Dimethylisoboldine, S-(+)-Glaucine |
| Compound Name | 1,2,9,10-Tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 355.178 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 355.178 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 355.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Esol | -4.2443292615384625 |
| Inchi | InChI=1S/C21H25NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3 |
| Smiles | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)OC)OC)OC |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Aporphines |
- 1. Outgoing r'ship
FOUND_INto/from Annona Reticulata (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Corydalis Yanhusuo (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Dicentra Eximia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Glaucium Flavum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Hordeum Vulgare (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Papaver Somniferum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all