Eremofukinone
PubChem CID: 101417485
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Eremofukinone |
|---|---|
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | YHPOLTFUARNADB-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | Eremofukinone |
| Heavy Atom Count | 16.0 |
| Compound Name | Eremofukinone |
| Kingdom | Organic compounds |
| Description | Constituent of rhizomes of wild Petasites japonicus (sweet coltsfoot). Eremofukinone is found in giant butterbur and green vegetables. |
| Exact Mass | 220.183 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 220.183 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 317.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 220.35 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 4,4a-dimethyl-6-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
| Total Atom Stereocenter Count | 4.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C15H24O/c1-10(2)12-6-7-13-14(16)8-5-11(3)15(13,4)9-12/h11-13H,1,5-9H2,2-4H3 |
| Smiles | CC1CCC(=O)C2C1(CC(CC2)C(=C)C)C |
| Xlogp | 4.3 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Sesquiterpenoids |
| Taxonomy Direct Parent | Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
| Molecular Formula | C15H24O |
- 1. Outgoing r'ship
FOUND_INto/from Petasites Japonicus (Plant) Rel Props:Source_db:fooddb_chem_all