5Z,8Z,11E,14Z,17Z-eicosapentaenoic acid
PubChem CID: 101408068
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5Z,8Z,11E,14Z,17Z-eicosapentaenoic acid, SCHEMBL18185540, LMFA01031116 |
|---|---|
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 22.0 |
| Pathway Kegg Map Id | map00592 |
| Description | Present in fish oils as an acylglycerol and in animal phospholipids. Nutriceutical with antioxidation props. Eicosapentaenoic acid (EPA or also icosapentaenoic acid) is an omega-3 fatty acid. In physiological literature, it is given the name 20:5(n-3). It also has the trivial name timnodonic acid. In chemical structure, EPA is a carboxylic acid with a 20-carbon chain and five cis double bonds, the first double bond is located at the third carbon from the omega end. It is obtained in the human diet by eating oily fish or fish oil— e.g., cod liver, herring, mackerel, salmon, menhaden and sardine. It is also found in human breast milk. [Wikipedia]. EPA is a biomarker for the consumption of salt-water fish. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 398.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Enzyme Uniprot Id | Q14032, O00154, P49753, Q8N9L9, O14734, P37231, Q03181, Q86TX2 |
| Iupac Name | (5Z,8Z,11E,14Z,17Z)-icosa-5,8,11,14,17-pentaenoic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Fatty Acyls |
| Xlogp | 5.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty acids and conjugates |
| Molecular Formula | C20H30O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JAZBEHYOTPTENJ-IKHGVYGUSA-N |
| Fcsp3 | 0.45 |
| Rotatable Bond Count | 13.0 |
| State | Solid |
| Synonyms | (5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17-Eicosapentaenoate, (5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17-Eicosapentaenoic acid, (5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoate, (5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoic acid, (5Z,8Z,11Z,14Z,17Z)-Icosa-5,8,11,14,17-pentaenoic acid, (5Z,8Z,11Z,14Z,17Z)-Icosapentaenoate, (5Z,8Z,11Z,14Z,17Z)-Icosapentaenoic acid, (all-cis)-5,8,11,14,17-Eicosapentaenoic acid, (all-Z)-5,8,11,14,17-Eicosapentaenoate, (all-Z)-5,8,11,14,17-Eicosapentaenoic acid, (all-Z)-Delta5,8,11,14,17-Eicosapentaenoic acid, (Z,Z,Z,Z,Z)-5,8,11,14,17-Eicosapentaenoic acid, 5,8,11,14,17-EICOSAPENTAENOate, 5,8,11,14,17-EICOSAPENTAENOIC ACID, 5,8,11,14,17-Eicosapentaenoic acid, (5Z,8Z,11Z,14Z,17Z)-, 5,8,11,14,17-Eicosapentaenoic acid, (all-Z)- (8CI), 5,8,11,14,17-Icosapentaenoate, 5,8,11,14,17-Icosapentaenoic acid, 5Z,8Z,11Z,14Z,17Z-Eicosapentaenoate, 5Z,8Z,11Z,14Z,17Z-Eicosapentaenoic acid, all-cis-5,8,11,14,17-Eicosapentaenoate, all-cis-5,8,11,14,17-Eicosapentaenoic acid, all-cis-Icosa-5,8,11,14,17-pentaenoate, all-cis-Icosa-5,8,11,14,17-pentaenoic acid, all-cis-Icosapentaenoate, all-cis-Icosapentaenoic acid, C20:5 omega-3, cis-5,8,11,14,17-Eicosapentaenoate, cis-5,8,11,14,17-Eicosapentaenoic acid, cis-5,8,11,14,17-EPA, cis-delta(5,8,11,14,17)-Eicosapentaenoate, cis-Delta(5,8,11,14,17)-Eicosapentaenoic acid, cis-δ(5,8,11,14,17)-eicosapentaenoate, cis-δ(5,8,11,14,17)-eicosapentaenoic acid, cis, cis, cis, cis, cis-Eicosa-5,8,11,14,17-pentaenoate, cis, cis, cis, cis, cis-Eicosa-5,8,11,14,17-pentaenoic acid, Eicosapentaenoate, EPA, Icosapent, Icosapent, INN, Icosapentaenoate, Icosapentaenoic acid, Icosapento, Icosapentum, Timnodonate, Timnodonic acid |
| Substituent Name | Long-chain fatty acid, Unsaturated fatty acid, Straight chain fatty acid, Monocarboxylic acid or derivatives, Carboxylic acid, Carboxylic acid derivative, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Aliphatic acyclic compound |
| Compound Name | 5Z,8Z,11E,14Z,17Z-eicosapentaenoic acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 302.225 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 302.225 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 302.5 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 5.0 |
| Esol | -4.8199396 |
| Inchi | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9+,13-12-,16-15- |
| Smiles | CC/C=C\C/C=C\C/C=C/C/C=C\C/C=C\CCCC(=O)O |
| Defined Bond Stereocenter Count | 5.0 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Brassica Oleracea (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Portulaca Oleracea (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Syzygium Aromaticum (Plant) Rel Props:Source_db:cmaup_ingredients