3-Caffeoylshikimic acid
PubChem CID: 10131826
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 3-O-Caffeoylshikimic acid, 3-caffeoylshikimic acid, 180981-12-8, trans-3-o-Caffeoylshikimic acid, 3-Csa, K891CTV013, UNII-K891CTV013, (3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-4,5-dihydroxycyclohexene-1-carboxylic acid, 1-Cyclohexene-1-carboxylic acid, 3-(((2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl)oxy)-4,5-dihydroxy-, (3R,4S,5R)-, 1-Cyclohexene-1-carboxylic acid, 3-((3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl)oxy)-4,5-dihydroxy-, (3R-(3alpha(E),4alpha,5beta))-, 1-CYCLOHEXENE-1-CARBOXYLIC ACID, 3-((3-(3,4-DIHYDROXYPHENYL)-1-OXO-2-PROPENYL)OXY)-4,5-DIHYDROXY-, (3R-(3.ALPHA.(E),4.ALPHA.,5.BETA.))-, (3R,4S,5R)-3-((E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl)oxy-4,5-dihydroxycyclohexene-1-carboxylic acid, (3R,4S,5R)-3-[[(2E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-4,5-dihydroxy-1-cyclohexene-1-carboxylic Acid, 3-Caffeoylshikimate, CHEBI:175268, FHA98112, AKOS040735525, HY-W728151, CS-0832336, Q27282084 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 145.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CCC1CCCCC1)CC1CCCCC1 |
| Np Classifier Class | Cinnamic acids and derivatives |
| Deep Smiles | O=CO[C@@H]C=CC[C@H][C@@H]6O))O)))C=O)O))))))/C=C/cccccc6)O))O |
| Heavy Atom Count | 24.0 |
| Classyfire Class | Cinnamic acids and derivatives |
| Scaffold Graph Node Level | OC(CCC1CCCCC1)OC1CCCCC1 |
| Classyfire Subclass | Hydroxycinnamic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 540.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-4,5-dihydroxycyclohexene-1-carboxylic acid |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 0.2 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C16H16O8 |
| Scaffold Graph Node Bond Level | O=C(C=Cc1ccccc1)OC1C=CCCC1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | MRDAXWGGWWDUKL-VKJPNVGWSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.25 |
| Logs | -1.299 |
| Rotatable Bond Count | 5.0 |
| Logd | 0.177 |
| Synonyms | 3-o-caffeoyl-shikimic |
| Esol Class | Very soluble |
| Functional Groups | CC(=CC)C(=O)O, CO, c/C=C/C(=O)OC, cO |
| Compound Name | 3-Caffeoylshikimic acid |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 336.085 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 336.085 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 336.29 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Esol | -1.9249352000000002 |
| Inchi | InChI=1S/C16H16O8/c17-10-3-1-8(5-11(10)18)2-4-14(20)24-13-7-9(16(22)23)6-12(19)15(13)21/h1-5,7,12-13,15,17-19,21H,6H2,(H,22,23)/b4-2+/t12-,13-,15+/m1/s1 |
| Smiles | C1[C@H]([C@@H]([C@@H](C=C1C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | False |
| Np Classifier Superclass | Phenylpropanoids (C6-C3) |
- 1. Outgoing r'ship
FOUND_INto/from Cichorium Glandulosum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cichorium Intybus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Smilax Glabra (Plant) Rel Props:Reference:ISBN:9788172362140