Marmelolactone A
PubChem CID: 101282726
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Marmelolactone A, CHEBI:195778, DTXSID301144282, 74133-35-0, (3R,5S)-3-methyl-5-[(1E)-3-methylbuta-1,3-dienyl]oxolan-2-one, (3R,5S)-Dihydro-3-methyl-5-[(1E)-3-methyl-1,3-butadien-1-yl]-2(3H)-furanone |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCC1 |
| Deep Smiles | CC=C)/C=C/[C@H]OC=O)[C@@H]C5)C |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Lactones |
| Scaffold Graph Node Level | OC1CCCO1 |
| Classyfire Subclass | Gamma butyrolactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 228.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (3R,5S)-3-methyl-5-[(1E)-3-methylbuta-1,3-dienyl]oxolan-2-one |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 2.7 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H14O2 |
| Scaffold Graph Node Bond Level | O=C1CCCO1 |
| Inchi Key | VOJBXZDIFIJUKD-HOMPQPGZSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | marmelolactone a |
| Esol Class | Soluble |
| Functional Groups | C=C(C)/C=C/C, COC(C)=O |
| Compound Name | Marmelolactone A |
| Exact Mass | 166.099 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 166.099 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 166.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H14O2/c1-7(2)4-5-9-6-8(3)10(11)12-9/h4-5,8-9H,1,6H2,2-3H3/b5-4+/t8-,9-/m1/s1 |
| Smiles | C[C@@H]1C[C@H](OC1=O)/C=C/C(=C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Cydonia Oblonga (Plant) Rel Props:Reference:The Unani Pharmacopoeia of India Part-1 Volume-2