methyl (E)-3-[(1R,2R,7S,8S,12S)-7-(furan-3-yl)-1,8,15,15-tetramethyl-5,17,18-trioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-12-yl]prop-2-enoate
PubChem CID: 101281327
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 122.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CC(C2CCCC2)C2CCC3C4CCCC4C(C)C(C)C3C23CC13 |
| Np Classifier Class | Limonoids |
| Deep Smiles | COC=O)/C=C/[C@@]COCC5C=O)C=O)[C@@]C9CC[C@@][C@@]6OC3C=O)O[C@H]7cccoc5)))))))))))C)))))C)))))C)C |
| Heavy Atom Count | 36.0 |
| Classyfire Class | Steroids and steroid derivatives |
| Scaffold Graph Node Level | OC1OC(C2CCOC2)C2CCC3C4COCC4C(O)C(O)C3C23OC13 |
| Classyfire Subclass | Steroid lactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1090.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | methyl (E)-3-[(1R,2R,7S,8S,12S)-7-(furan-3-yl)-1,8,15,15-tetramethyl-5,17,18-trioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-12-yl]prop-2-enoate |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 1.7 |
| Is Pains | True |
| Gsk 4 400 Rule | False |
| Molecular Formula | C27H30O9 |
| Scaffold Graph Node Bond Level | O=C1C(=O)C2C(CCC3C(c4ccoc4)OC(=O)C4OC432)C2COCC12 |
| Inchi Key | LDDPNRPNOHWFQH-XVHSPFGVSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | dehydroatalantin |
| Esol Class | Soluble |
| Functional Groups | CC(=O)C(C)=O, COC, COC(=O)/C=C/C, C[C@]12CCOC(=O)C1O2, coc |
| Compound Name | methyl (E)-3-[(1R,2R,7S,8S,12S)-7-(furan-3-yl)-1,8,15,15-tetramethyl-5,17,18-trioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-12-yl]prop-2-enoate |
| Exact Mass | 498.189 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 498.189 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 498.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C27H30O9/c1-23(2)18-17(29)19(30)25(4)15(26(18,13-34-23)10-7-16(28)32-5)6-9-24(3)20(14-8-11-33-12-14)35-22(31)21-27(24,25)36-21/h7-8,10-12,15,18,20-21H,6,9,13H2,1-5H3/b10-7+/t15?,18?,20-,21?,24-,25-,26-,27+/m0/s1 |
| Smiles | C[C@@]12CCC3[C@]([C@@]14C(O4)C(=O)O[C@H]2C5=COC=C5)(C(=O)C(=O)C6[C@]3(COC6(C)C)/C=C/C(=O)OC)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Atalantia Monophylla (Plant) Rel Props:Reference:ISBN:9788185042084