Peonidin 3-(6''-malonyl-glucoside) 5-glucoside
PubChem CID: 101268578
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Peonidin 3-(6''-malonyl-glucoside) 5-glucoside |
|---|---|
| Topological Polar Surface Area | 293.0 |
| Hydrogen Bond Donor Count | 10.0 |
| Inchi Key | AEMHVTCADJQUIP-UPJXQTEWSA-O |
| Rotatable Bond Count | 12.0 |
| Heavy Atom Count | 50.0 |
| Compound Name | Peonidin 3-(6''-malonyl-glucoside) 5-glucoside |
| Description | Peonidin 3-(6''-malonyl-glucoside) 5-glucoside is a member of the class of compounds known as anthocyanidin-5-o-glycosides. Anthocyanidin-5-o-glycosides are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C5-position. Peonidin 3-(6''-malonyl-glucoside) 5-glucoside is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Peonidin 3-(6''-malonyl-glucoside) 5-glucoside can be found in garden onion, which makes peonidin 3-(6''-malonyl-glucoside) 5-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 711.177 |
| Formal Charge | 1.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 711.177 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1130.0 |
| Hydrogen Bond Acceptor Count | 18.0 |
| Molecular Weight | 711.6 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | 3-oxo-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methoxy]propanoic acid |
| Total Atom Stereocenter Count | 10.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C31H34O19/c1-44-17-4-11(2-3-14(17)34)29-18(48-31-28(43)26(41)24(39)20(50-31)10-45-22(37)8-21(35)36)7-13-15(46-29)5-12(33)6-16(13)47-30-27(42)25(40)23(38)19(9-32)49-30/h2-7,19-20,23-28,30-32,38-43H,8-10H2,1H3,(H2-,33,34,35,36)/p+1/t19-,20-,23-,24-,25+,26+,27-,28-,30-,31-/m1/s1 |
| Smiles | COC1=C(C=CC(=C1)C2=C(C=C3C(=CC(=CC3=[O+]2)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)COC(=O)CC(=O)O)O)O)O)O |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C31H35O19+ |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Source_db:fooddb_chem_all