(3S,4S)-2-(3,4-dihydroxyphenyl)-4-[(3S,4R)-2-(3,4-dihydroxyphenyl)-4-[(3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-8-[(3S,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol
PubChem CID: 101236698
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 442.0 |
| Hydrogen Bond Donor Count | 20.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC(C2CCC3CCCC(C4CC(C5CCCCC5)CC5C4CCCC5C4CC(C5CCCCC5)CC5C(C6CC(C7CCCCC7)CC7CCCCC76)CCCC54)C3C2)CC1 |
| Np Classifier Class | Proanthocyanins |
| Deep Smiles | OcccO)ccc6)OC[C@H][C@@H]6ccO)cccc6OCcccccc6)O))O)))))[C@H][C@@H]6ccO)cccc6OCcccccc6)O))O)))))[C@H][C@@H]6ccO)cccc6OC[C@H]C6)O))cccccc6)O))O)))))))))O))))))O))))))O))))))O))))))O))))))O))cccccc6)O))O |
| Heavy Atom Count | 84.0 |
| Classyfire Class | Flavonoids |
| Scaffold Graph Node Level | C1CCC(C2CC(C3CCCC4C(C5CCCC6C(C7CCCC8CCC(C9CCCCC9)OC87)CC(C7CCCCC7)OC65)CC(C5CCCCC5)OC34)C3CCCCC3O2)CC1 |
| Classyfire Subclass | Biflavonoids and polyflavonoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 2210.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 7.0 |
| Iupac Name | (3S,4S)-2-(3,4-dihydroxyphenyl)-4-[(3S,4R)-2-(3,4-dihydroxyphenyl)-4-[(3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-8-[(3S,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 4.3 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C60H50O24 |
| Scaffold Graph Node Bond Level | c1ccc(C2CC(c3cccc4c3OC(c3ccccc3)CC4c3cccc4c3OC(c3ccccc3)CC4c3cccc4c3OC(c3ccccc3)CC4)c3ccccc3O2)cc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | QFLMUASKTWGRQE-CPKTYMGRSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.2 |
| Logs | -3.693 |
| Rotatable Bond Count | 7.0 |
| Logd | 2.132 |
| Synonyms | catechin tetramer |
| Esol Class | Poorly soluble |
| Functional Groups | CO, cO, cOC |
| Compound Name | (3S,4S)-2-(3,4-dihydroxyphenyl)-4-[(3S,4R)-2-(3,4-dihydroxyphenyl)-4-[(3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-8-[(3S,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 1154.27 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 1154.27 |
| Hydrogen Bond Acceptor Count | 24.0 |
| Molecular Weight | 1155.0 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 11.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Esol | -9.64588034285715 |
| Inchi | InChI=1S/C60H50O24/c61-23-13-34(71)42-41(14-23)81-55(20-2-6-26(63)31(68)10-20)51(78)48(42)44-36(73)17-38(75)46-50(53(80)57(83-59(44)46)22-4-8-28(65)33(70)12-22)47-39(76)18-37(74)45-49(52(79)56(84-60(45)47)21-3-7-27(64)32(69)11-21)43-35(72)16-29(66)24-15-40(77)54(82-58(24)43)19-1-5-25(62)30(67)9-19/h1-14,16-18,40,48-57,61-80H,15H2/t40-,48-,49+,50-,51-,52-,53-,54?,55?,56?,57?/m0/s1 |
| Smiles | C1[C@@H](C(OC2=C1C(=CC(=C2[C@H]3[C@@H](C(OC4=C3C(=CC(=C4[C@H]5[C@@H](C(OC6=C(C(=CC(=C56)O)O)[C@H]7[C@@H](C(OC8=CC(=CC(=C78)O)O)C9=CC(=C(C=C9)O)O)O)C1=CC(=C(C=C1)O)O)O)O)O)C1=CC(=C(C=C1)O)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
| Nring | 12.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Catechu (Plant) Rel Props:Reference:ISBN:9788172363178 - 2. Outgoing r'ship
FOUND_INto/from Aconitum Coreanum (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Aconitum Palmatum (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Aconitum Tanguticum (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Cnidium Officinale (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Cynoglossum Officinale (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Dracocephalum Tanguticum (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Euphrasia Officinale (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Guaiacum Officinale (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Hyssopus Officinale (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Jasminum Officinale (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Levisticum Officinale (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Lithospermum Officinale (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Nasturtium Officinale (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Peucedanum Officinale (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Rheum Australe (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Rheum Coreanum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Rheum Emodi (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Rheum Hotaoense (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Rheum Maximowiczii (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Rheum Moorcrofianum (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Rheum Moorcroftianum (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Rheum Nanum (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Rheum Officinale (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 25. Outgoing r'ship
FOUND_INto/from Rheum Palmatum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 26. Outgoing r'ship
FOUND_INto/from Rheum Qinlingense (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Rheum Rhaponticum (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Rheum Sp (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Rheum Spiciforme (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Rheum Tanguticum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 31. Outgoing r'ship
FOUND_INto/from Rheum Undulatum (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Rheum Webbianum (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Rheum Wittrocki (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Schoenocaulon Officinale (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Sisymbrium Officinale (Plant) Rel Props:Reference: - 36. Outgoing r'ship
FOUND_INto/from Symphytum Officinale (Plant) Rel Props:Reference: - 37. Outgoing r'ship
FOUND_INto/from Taraxacum Coreanum (Plant) Rel Props:Reference: - 38. Outgoing r'ship
FOUND_INto/from Taraxacum Officinale (Plant) Rel Props:Reference: - 39. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Reference: