Lepidine F
PubChem CID: 100927768
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Lepidine F, CHEBI:175383, 2-[4-hydroxy-2-(1H-imidazol-2-ylmethyl)phenyl]-4-(1H-imidazol-2-ylmethyl)phenol |
|---|---|
| Topological Polar Surface Area | 97.8 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 26.0 |
| Description | Alkaloid from the seeds of Lepidium sativum (garden cress). Lepidine F is found in garden cress and brassicas. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 452.0 |
| Database Name | fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[4-hydroxy-2-(1H-imidazol-2-ylmethyl)phenyl]-4-(1H-imidazol-2-ylmethyl)phenol |
| Nih Violation | False |
| Class | Benzene and substituted derivatives |
| Xlogp | 3.0 |
| Superclass | Benzenoids |
| Is Pains | False |
| Subclass | Biphenyls and derivatives |
| Molecular Formula | C20H18N4O2 |
| Inchi Key | XQANLWORMFUCPG-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| Substituent Name | Biphenyl, Phenol, Heteroaromatic compound, Imidazole, Azole, Azacycle, Organoheterocyclic compound, Hydrocarbon derivative, Organooxygen compound, Organonitrogen compound, Aromatic heteromonocyclic compound |
| Compound Name | Lepidine F |
| Kingdom | Organic compounds |
| Exact Mass | 346.143 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 346.143 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 346.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C20H18N4O2/c25-15-2-3-16(14(11-15)12-20-23-7-8-24-20)17-9-13(1-4-18(17)26)10-19-21-5-6-22-19/h1-9,11,25-26H,10,12H2,(H,21,22)(H,23,24) |
| Smiles | C1=CC(=C(C=C1CC2=NC=CN2)C3=C(C=C(C=C3)O)CC4=NC=CN4)O |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Lepidium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all