methyl (1R,9R,10S,11R,12R,19R)-11-acetyloxy-12-ethyl-4-[(13R,15S,17R)-17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraen-13-yl]-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate
PubChem CID: 100925385
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 154.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CCC3C4CCCCC4CC3C(C3CCC4CC5CCC6CCCC7CCC5(C4C3)C67)CC(C1)C2 |
| Np Classifier Class | Aspidosperma type, Aspidosperma-Iboga hybrid type (Vinca alkaloids) |
| Deep Smiles | COcccNC)[C@@H][C@@]c5cc9[C@@]C[C@@H]CNCCcc9[nH]cc5cccc6)))))))))))C[C@@]C6)O)CC))))))))C=O)OC)))))))CCN[C@H]5[C@@][C@H][C@]9O)C=O)OC))))OC=O)C))))CC))C=CC6 |
| Heavy Atom Count | 59.0 |
| Classyfire Class | Vinca alkaloids |
| Scaffold Graph Node Level | C1CCC2C(C1)NC1C(C3CCC4NC5CCC6CCCN7CCC5(C4C3)C67)CC3CCCN(CCC21)C3 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1700.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 9.0 |
| Iupac Name | methyl (1R,9R,10S,11R,12R,19R)-11-acetyloxy-12-ethyl-4-[(13R,15S,17R)-17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraen-13-yl]-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 3.7 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C46H58N4O9 |
| Scaffold Graph Node Bond Level | C1=CC2CCC3Nc4ccc(C5CC6CCCN(CCc7c5[nH]c5ccccc75)C6)cc4C34CCN(C1)C24 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JXLYSJRDGCGARV-UHHJTAMBSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.5869565217391305 |
| Logs | -4.74 |
| Rotatable Bond Count | 10.0 |
| Logd | 3.044 |
| Synonyms | vincovaline |
| Esol Class | Poorly soluble |
| Functional Groups | CC(=O)OC, CC=CC, CN(C)C, CO, COC(C)=O, cN(C)C, cOC, c[nH]c |
| Compound Name | methyl (1R,9R,10S,11R,12R,19R)-11-acetyloxy-12-ethyl-4-[(13R,15S,17R)-17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraen-13-yl]-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 810.42 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 810.42 |
| Hydrogen Bond Acceptor Count | 12.0 |
| Molecular Weight | 811.0 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 9.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Esol | -6.840667393220338 |
| Inchi | InChI=1S/C46H58N4O9/c1-8-42(54)23-28-24-45(40(52)57-6,36-30(15-19-49(25-28)26-42)29-13-10-11-14-33(29)47-36)32-21-31-34(22-35(32)56-5)48(4)38-44(31)17-20-50-18-12-16-43(9-2,37(44)50)39(59-27(3)51)46(38,55)41(53)58-7/h10-14,16,21-22,28,37-39,47,54-55H,8-9,15,17-20,23-26H2,1-7H3/t28-,37+,38-,39-,42-,43-,44-,45-,46+/m1/s1 |
| Smiles | CC[C@]1(C[C@@H]2C[C@](C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)[C@]78CCN9[C@H]7[C@@](C=CC9)([C@H]([C@@]([C@@H]8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O |
| Nring | 9.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Boerhavia Erecta (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Catharanthus Lanceus (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Catharanthus Longifolius (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Catharanthus Ovalis (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Catharanthus Pusillus (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Catharanthus Roseus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all; Reference: - 7. Outgoing r'ship
FOUND_INto/from Commelina Erecta (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Duranta Erecta (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Eclipta Erecta (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Hygrophila Erecta (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Nepeta Erecta (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Senecio Roseus (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Stephania Erecta (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Tagetes Erecta (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Thunbergia Erecta (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Vinca Erecta (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Vinca Herbacea (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Vinca Major (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Vinca Minor (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Vinca Parviflora (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Vinca Pusilla (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Vinca Rosea (Plant) Rel Props:Reference: