Avenanthramide B
PubChem CID: 10087955
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Avenanthramide B, Avenanthramide 1, 108605-69-2, Avenanthramide BF, Avenanthramide 2F, F8BQ5730IL, UNII-F8BQ5730IL, N-feruloyl-5-hydroxyanthranilic acid, 5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid, Benzoic acid, 5-hydroxy-2-(((2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl)amino)-, CHEBI:167489, DTXSID50148603, 5-Hydroxy-2-(((2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoyl)amino)benzoic acid, Benzoic acid, 5-hydroxy-2-[[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]amino]-, (Z)-N-Feruloyl-5-hydroxyanthranilic acid, N-[4'-hydroxy-3'-methoxy-(E)-cinnamoyl]-5-hydroxyanthranilic acid, 5-hydroxy-2-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]amino}benzoic acid, 5-hydroxy-2-{[(2e)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino}benzoic acid, N-(4'-hydroxy-3'-methoxy-(E)-cinnamoyl)-5-hydroxyanthranilic acid, 5-hydroxy-2-(((2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl)amino)benzoic acid, 5-hydroxy-2-(((2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl)amino)benzoic acid, 5-hydroxy-2-(((E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl)amino)benzoic acid, SCHEMBL4671925, SCHEMBL6013366, DTXCID5071094, Avenanthramide B, analytical standard, Q27277808, N-(4'-hydroxy-3'methoxy-(e)-cinnamoyl)-5-hydroxyanthranilic acid, (E)-5-Hydroxy-2-(3-(4-hydroxy-3-methoxyphenyl)acrylamido)benzoic acid, 5-hydroxy-2-[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamido]benzoic acid |
|---|---|
| Topological Polar Surface Area | 116.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 24.0 |
| Description | Avenanthramide b is a member of the class of compounds known as avenanthramides. Avenanthramides are a group of phenolic alkaloids consisting of conjugate of three phenylpropanoids (ferulic, caffeic, or p-coumaric acid) and anthranilic acid. Avenanthramide b is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Avenanthramide b can be found in cereals and cereal products, which makes avenanthramide b a potential biomarker for the consumption of this food product. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 480.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Cinnamic acids and derivatives |
| Xlogp | 2.5 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Subclass | Hydroxycinnamic acids and derivatives |
| Molecular Formula | C17H15NO6 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JXFZHMCSCYADIX-XVNBXDOJSA-N |
| Fcsp3 | 0.0588235294117647 |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Synonyms | Avenanthramide A1, Avenanthramide B (Collins), N-[4'-Hydroxy-3'-methoxy-(E)-cinnamoyl]-5-hydroxyanthranilic acid, 5-Hydroxy-2-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]amino}benzoic acid, Avenanthramide 1, Avenanthramide 2F, Avenanthramide BF, N-[4'-Hydroxy-3'-methoxy-(e)-cinnamoyl]-5-hydroxyanthranilic acid, N-Feruloyl-5-hydroxyanthranilic acid, 5-Hydroxy-2-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]amino}benzoate, N-[4'-Hydroxy-3'-methoxy-(e)-cinnamoyl]-5-hydroxyanthranilate, N-Feruloyl-5-hydroxyanthranilate, (Z)-N-Feruloyl-5-hydroxyanthranilate, Avenanthramide b, 5-Hydroxy-2-{[(2E)-1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-ylidene]amino}benzoate |
| Compound Name | Avenanthramide B |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 329.09 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 329.09 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 329.3 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Esol | -3.443309600000001 |
| Inchi | InChI=1S/C17H15NO6/c1-24-15-8-10(2-6-14(15)20)3-7-16(21)18-13-5-4-11(19)9-12(13)17(22)23/h2-9,19-20H,1H3,(H,18,21)(H,22,23)/b7-3+ |
| Smiles | COC1=C(C=CC(=C1)/C=C/C(=O)NC2=C(C=C(C=C2)O)C(=O)O)O |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Avenanthramides |
- 1. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:cmaup_ingredients